Merge pull request 'upstream' (#402 ) from wowario/wownero:upstream into master

Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/402
remove unbound
2026-03-05 06:07:35 -05:00 · 2021-07-12 18:04:52 +00:00 · 2021-07-12 20:51:39 +03:00 · 2021-07-12 20:31:04 +03:00 · 2021-07-12 20:27:05 +03:00 · 2021-07-12 20:16:55 +03:00
51 changed files with 1769 additions and 186 deletions
--- a/.github/workflows/build.yml
+++ b/.github/workflows/build.yml
@@ -54,7 +54,7 @@ jobs:
    - uses: eine/setup-msys2@v2
      with:
        update: true
-        install: mingw-w64-x86_64-toolchain make mingw-w64-x86_64-cmake mingw-w64-x86_64-ccache mingw-w64-x86_64-boost mingw-w64-x86_64-openssl mingw-w64-x86_64-zeromq mingw-w64-x86_64-libsodium mingw-w64-x86_64-hidapi mingw-w64-x86_64-protobuf-c mingw-w64-x86_64-libusb git
+        install: mingw-w64-x86_64-toolchain make mingw-w64-x86_64-cmake mingw-w64-x86_64-ccache mingw-w64-x86_64-boost mingw-w64-x86_64-openssl mingw-w64-x86_64-zeromq mingw-w64-x86_64-libsodium mingw-w64-x86_64-hidapi mingw-w64-x86_64-protobuf-c mingw-w64-x86_64-libusb mingw-w64-x86_64-unbound git
    - name: build
      run: |
        ccache --max-size=150M
--- a/.gitmodules
+++ b/.gitmodules
@@ -1,7 +1,3 @@
-[submodule "external/unbound"]
-	path = external/unbound
-	url = https://github.com/monero-project/unbound
-	branch = monero
 [submodule "external/miniupnp"]
 	path = external/miniupnp
 	url = https://github.com/miniupnp/miniupnp
--- a/CMakeLists.txt
+++ b/CMakeLists.txt
@@ -307,7 +307,6 @@ if(NOT MANUAL_SUBMODULES)
    
    message(STATUS "Checking submodules")
    check_submodule(external/miniupnp)
-    check_submodule(external/unbound)
    check_submodule(external/rapidjson)
    check_submodule(external/RandomWOW)
    check_submodule(external/supercop)
@@ -612,8 +611,7 @@ include_directories("${CMAKE_CURRENT_BINARY_DIR}/translations")
 add_subdirectory(external)

 # Final setup for libunbound
-include_directories(${UNBOUND_INCLUDE})
-link_directories(${UNBOUND_LIBRARY_DIRS})
+include_directories(${UNBOUND_INCLUDE_DIR})

 # Final setup for easylogging++
 include_directories(${EASYLOGGING_INCLUDE})
--- a/README.md
+++ b/README.md
@@ -26,7 +26,7 @@ Portions Copyright (c) 2012-2013 The Cryptonote developers.

 ### Blockchain Explorers
 - https://explore.wownero.com
- http://wow5eqtzqvsg5jctqzg5g7uk3u62sfqiacj5x6lo4by7bvnj6jkvubyd.onion
+- http://gffjxd5nn2heslj6jv5ts2ok5j6xi6m3pwlpz7le4i5bu56sirbxfiqd.onion:8081
 - https://wownero.club
 - https://explorer.wownero.fyi

@@ -91,7 +91,7 @@ Dates are provided in the format YYYY-MM-DD.
 | 160,777                          | 2019-11-20 | Gaping Goatse    | v0.7.0.0               | v0.7.1.0                  | Only allow >= 2 outputs, change to the block median used to calculate penalty, rct sigs in coinbase forbidden, 4 unlock time as protocol rule
 | -                         | 2020-06-28 | Hallucinogenic Hypnotoad  | v0.8.0.0               | v0.8.0.2                  | Dandelion++ support
 | 253,999                         | 2020-10-09 | Illiterate Illuminati  | v0.9.0.0               | v0.9.3.3                  | Dynamic coinbase unlock (up to 1 mo.), Deterministic unlock times, Enforce maximum coinbase amount, show_qr_code wallet command, CLSAG
-| 331,170                         | 2021-07-04 | Junkie Jeff  | v0.10.0.0               |  v0.10.0.0                  | Bulletproofs+, Miner Block Header Signing, Vote by Block, Change coinbase unlock time to 1 day, Reset difficulty and switch back to Monero's difficulty algorithm
+| 331,170                         | 2021-07-04 | Junkie Jeff  | v0.10.0.0               |  v0.10.0.2                  | Bulletproofs+, Miner Block Header Signing, Vote by Block, Change coinbase unlock time to 1 day, Reset difficulty and switch back to Monero's difficulty algorithm

 X's indicate that these details have not been determined as of commit date.

@@ -170,10 +170,10 @@ To run in background:

 To run as a systemd service, copy
 [wownerod.service](utils/systemd/wownerod.service) to `/etc/systemd/system/` and
-[wownerod.conf](utils/conf/wownerod.conf) to `/etc/`. The [example
+[wownerod.conf](wownerod.conf) to `/etc/`. The [example
 service](utils/systemd/wownerod.service) assumes that the user `wownero` exists
 and its home is the data directory specified in the [example
-config](utils/conf/wownerod.conf).
+config](wownerod.conf).

 Once node is synced to network, run the CLI wallet by entering:

@@ -183,26 +183,37 @@ Type `help` in CLI wallet to see standard commands (for advanced options, type `

 ## Tor Anonymity Network

-* Install [Tor Browser](https://www.torproject.org/download/)
-* Open `torrc` file in a text editor ([installation directory]/Browser/TorBrowser/Data/Tor/torrc) and add hidden service information as follows:
+### Ubuntu

+* `sudo apt-get update && sudo apt-get install tor -y`
+* `sudo nano /etc/tor/torrc`
+
+add the following:
 ```
-HiddenServiceDir [installation directory]/Browser/TorBrowser/Data/Tor/wow_node
+HiddenServiceDir /var/lib/tor/wownero/
+HiddenServicePort 34568 127.0.0.1:34568
+HiddenServicePort 34566 127.0.0.1:34566
 HiddenServiceVersion 3
-HiddenServicePort 44568 127.0.0.1:44568
 ```
-* Save `torrc` file and restart Tor Browser (keep open)
-* Change directory to the `wow_node` folder, open `hostname` file, and copy your node's ".onion" address
-* Start wownerod with the following parameters:
+save and close nano
+
+* `sudo /etc/init.d/tor restart && sudo systemctl enable tor`
+* copy [wownerod.conf](https://git.wownero.com/wownero/wownero/raw/branch/master/wownerod.conf) file and save it in same directory as `wownerod`.
+* start wownerod like this:

 ```
-./wownerod --tx-proxy tor,127.0.0.1:9150,10 --add-peer hdps3qwnusz64r7odvynmae6myc2uyvrsc2emap6636qeuzll72eouid.onion:44568 --anonymous-inbound YOUR_NODE_ADDRESS.onion:44568,127.0.0.1:44568,25
+./wownerod --config-file=wownerod.conf
 ```

+* `sudo cat /var/lib/tor/wownero/hostname`
+copy your onion address and share node with others [here](https://monero.fail/?crypto=wownero) and [here](https://forum.wownero.com/t/wownero-tor-onion-sites/623)
+
+To share your node over p2p, uncomment first line of wownerod.conf and add your onion address.
+
+More information on running Tor and i2p nodes is available [here](https://forum.wownero.com/t/how-to-setup-a-full-node-with-tor-i2p/588)
+
 ### Access remote Tor node from CLI wallet

 ```
-./wownero-wallet-cli --proxy 127.0.0.1:9150 --daemon-address wow7dhbgiljnkspkzpjyy66auegbrye2ptfv4gucgbhireg5rrjza5ad.onion:34568
+./wownero-wallet-cli --proxy 127.0.0.1:9050 --daemon-address iy6ry6uudpzvbd72zsipepukp6nsazjdu72n52vg3isfnxqn342flzad.onion:34568
 ```
-
-Use port `9050` instead of `9150` if you installed Tor as a standalone daemon. For more information, check out [ANONYMITY_NETWORKS](https://git.wownero.com/wownero/wownero/src/branch/master/ANONYMITY_NETWORKS.md).
--- a/contrib/depends/packages/expat.mk
+++ b/contrib/depends/packages/expat.mk
@@ -1,8 +1,8 @@
 package=expat
-$(package)_version=2.2.4
-$(package)_download_path=https://github.com/libexpat/libexpat/releases/download/R_2_2_4
+$(package)_version=2.4.1
+$(package)_download_path=https://github.com/libexpat/libexpat/releases/download/R_2_4_1
 $(package)_file_name=$(package)-$($(package)_version).tar.bz2
-$(package)_sha256_hash=03ad85db965f8ab2d27328abcf0bc5571af6ec0a414874b2066ee3fdd372019e
+$(package)_sha256_hash=2f9b6a580b94577b150a7d5617ad4643a4301a6616ff459307df3e225bcfbf40

 define $(package)_set_vars
 $(package)_config_opts=--enable-static
--- a/contrib/depends/packages/ldns.mk
+++ b/contrib/depends/packages/ldns.mk
@@ -1,8 +1,8 @@
 package=ldns
-$(package)_version=1.6.17
-$(package)_download_path=https://www.nlnetlabs.nl/downloads/ldns/
+$(package)_version=1.7.1
+$(package)_download_path=https://www.nlnetlabs.nl/downloads/$(package)/
 $(package)_file_name=$(package)-$($(package)_version).tar.gz
-$(package)_sha256_hash=8b88e059452118e8949a2752a55ce59bc71fa5bc414103e17f5b6b06f9bcc8cd
+$(package)_sha256_hash=8ac84c16bdca60e710eea75782356f3ac3b55680d40e1530d7cea474ac208229
 $(package)_dependencies=openssl

 define $(package)_set_vars
--- a/contrib/depends/packages/packages.mk
+++ b/contrib/depends/packages/packages.mk
@@ -1,4 +1,4 @@
-packages:=boost openssl zeromq libiconv
+packages:=boost openssl zeromq libiconv expat ldns unbound

 native_packages := native_ccache

--- a/contrib/depends/packages/unbound.mk
+++ b/contrib/depends/packages/unbound.mk
@@ -1,12 +1,12 @@
 package=unbound
-$(package)_version=1.6.8
-$(package)_download_path=https://www.unbound.net/downloads/
+$(package)_version=1.13.1
+$(package)_download_path=https://www.nlnetlabs.nl/downloads/$(package)/
 $(package)_file_name=$(package)-$($(package)_version).tar.gz
-$(package)_sha256_hash=e3b428e33f56a45417107448418865fe08d58e0e7fea199b855515f60884dd49
+$(package)_sha256_hash=8504d97b8fc5bd897345c95d116e0ee0ddf8c8ff99590ab2b4bd13278c9f50b8
 $(package)_dependencies=openssl expat ldns

 define $(package)_set_vars
-  $(package)_config_opts=--disable-shared --enable-static --without-pyunbound --prefix=$(host_prefix) --with-libexpat=$(host_prefix) --with-ssl=$(host_prefix) --with-libevent=no --without-pythonmodule --disable-flto --with-pthreads
+  $(package)_config_opts=--disable-shared --enable-static --without-pyunbound --prefix=$(host_prefix) --with-libexpat=$(host_prefix) --with-ssl=$(host_prefix) --with-libevent=no --without-pythonmodule --disable-flto --with-pthreads --with-libunbound-only
  $(package)_config_opts_linux=--with-pic
  $(package)_config_opts_w64=--enable-static-exe --sysconfdir=/etc --prefix=$(host_prefix) --target=$(host_prefix)
  $(package)_build_opts_mingw32=LDFLAGS="$($(package)_ldflags) -lpthread"
--- a/contrib/depends/toolchain.cmake.in
+++ b/contrib/depends/toolchain.cmake.in
@@ -24,6 +24,9 @@ SET(Readline_INCLUDE_DIR @prefix@/include)
 SET(Readline_LIBRARY @prefix@/lib/libreadline.a)
 SET(Terminfo_LIBRARY @prefix@/lib/libtinfo.a)

+SET(UNBOUND_INCLUDE_DIR @prefix@/include)
+SET(UNBOUND_LIBRARIES @prefix@/lib/libunbound.a)
+
 SET(LRELEASE_PATH @prefix@/native/bin CACHE FILEPATH "path to lrelease" FORCE)

 if(NOT CMAKE_SYSTEM_NAME STREQUAL "Android")
--- a/contrib/tor/wownero-over-tor.sh
+++ b/contrib/tor/wownero-over-tor.sh
@@ -42,7 +42,9 @@ CookieAuthentication 1
 CookieAuthFile $TORDIR/control.authcookie
 CookieAuthFileGroupReadable 1
 HiddenServiceDir $TORDIR
-HiddenServicePort 38083 127.0.0.1:38083
+HiddenServicePort 34568 127.0.0.1:34568
+HiddenServicePort 34566 127.0.0.1:34566
+HiddenServiceVersion 3
 EOF

 echo "Starting Tor..."
@@ -67,9 +69,15 @@ fi
 echo "Starting wownerod..."
 HOSTNAME=$(cat "$HOSTNAMEFILE")
 "$monerod" \
-  --anonymous-inbound "$HOSTNAME":38083,127.0.0.1:38083,25 --tx-proxy tor,127.0.0.1:9050,10 \
-  --add-priority-node zbjkbsxc5munw3qusl7j2hpcmikhqocdf4pqhnhtpzw5nt5jrmofptid.onion:38083 \
-  --add-priority-node 2xmrnode5itf65lz.onion:38083 \
+  --anonymous-inbound "$HOSTNAME":34566,127.0.0.1:34566,25 --tx-proxy tor,127.0.0.1:9050,10 \
+  --add-priority-node v2admi6gbeprxnk6i2oscizhgy4v5ixu6iezkhj5udiwbfjjs2w7dnid.onion:34568 \
+  --add-priority-node iy6ry6uudpzvbd72zsipepukp6nsazjdu72n52vg3isfnxqn342flzad.onion:34568 \
+  --add-priority-node 7ftpbpp6rbgqi5kjmhyin46essnh3eqb3m3rhfi7r2fr33iwkeuer3yd.onion:34568 \
+  --add-priority-node j7rf2jcccizcp47y5moehguyuqdpg4lusk642sw4nayuruitqaqbc7ad.onion:34568 \
+  --add-priority-node aje53o5z5twne5q2ljw44zkahhsuhjtwaxuburxddbf7n4pfsj4rj6qd.onion:34568 \
+  --add-priority-node nepc4lxndsooj2akn7ofrj3ooqc25242obchcag6tw3f2mxrms2uuvyd.onion:34568 \
+  --add-priority-node 666l2ajxqjgj5lskvbokvworjysgvqag4oitokjuy7wz6juisul4jqad.onion:34568 \
+  --add-priority-node ty7ppqozzodz75audgvkprekiiqsovbyrkfdjwadrkbe3etyzloatxad.onion:34568 \
  --detach
 ready=0
 for i in `seq 10`
--- a/external/CMakeLists.txt
+++ b/external/CMakeLists.txt
@@ -55,26 +55,12 @@ set(UPNP_LIBRARIES "libminiupnpc-static" PARENT_SCOPE)

 find_package(Unbound)

-if(NOT UNBOUND_INCLUDE_DIR OR STATIC)
-  # NOTE: If STATIC is true, CMAKE_FIND_LIBRARY_SUFFIXES has been reordered.
-  # unbound has config tests which used OpenSSL libraries, so -ldl may need to
-  # be set in this case.
-  # The unbound CMakeLists.txt can set it, since it's also needed for the
-  # static OpenSSL libraries set up there after with target_link_libraries.
-  add_subdirectory(unbound)
-
-  set(UNBOUND_STATIC true PARENT_SCOPE)
-  set(UNBOUND_INCLUDE "${CMAKE_CURRENT_SOURCE_DIR}/unbound/libunbound" PARENT_SCOPE)
-  set(UNBOUND_LIBRARY "unbound" PARENT_SCOPE)
-  set(UNBOUND_LIBRARY_DIRS "${LIBEVENT2_LIBDIR}" PARENT_SCOPE)
+if(NOT UNBOUND_INCLUDE_DIR)
+  die("Could not find libunbound")
 else()
  message(STATUS "Found libunbound include (unbound.h) in ${UNBOUND_INCLUDE_DIR}")
  if(UNBOUND_LIBRARIES)
-    message(STATUS "Found libunbound shared library")
-    set(UNBOUND_STATIC false PARENT_SCOPE)
-    set(UNBOUND_INCLUDE ${UNBOUND_INCLUDE_DIR} PARENT_SCOPE)
-    set(UNBOUND_LIBRARY ${UNBOUND_LIBRARIES} PARENT_SCOPE)
-    set(UNBOUND_LIBRARY_DIRS "" PARENT_SCOPE)
+    message(STATUS "Found libunbound library")
  else()
    die("Found libunbound includes, but could not find libunbound library. Please make sure you have installed libunbound or libunbound-dev or the equivalent")
  endif()
--- a/external/unbound
+++ b/external/unbound
--- a/src/blocks/checkpoints.dat
+++ b/src/blocks/checkpoints.dat
--- a/src/checkpoints/checkpoints.cpp
+++ b/src/checkpoints/checkpoints.cpp
@@ -220,6 +220,11 @@ namespace cryptonote
    ADD_CHECKPOINT2(312130,  "e0da085bd273fff9f5f8e604fce0e91908bc62b6b004731a93e16e89cb9b1f54", "0x3cfe7148f2e18");
    ADD_CHECKPOINT2(324600,  "b24cd1ed7c192bbcf3d5b15729f2b032566687f96bda6f8cb73a5b16df4c6e6b", "0x69caecbe78718");
    ADD_CHECKPOINT2(327700,  "f113c8cbe077aab9296ecbfb41780c147aeb54edfece7e4b9946b8abd0f06de7", "0x732431429c818");
+    ADD_CHECKPOINT2(331170,  "05243fba853fe375c671a6783eecac28777bca51f5977d5285c235424e52bb69", "0x7c3469310d218"); //Hard fork to v18
+    ADD_CHECKPOINT2(331458,  "f79a664a5e4bc11fa7d804be2c3c72db50c87a27f1f540f337564cbb6314e4cd", "0x7c34d47adf218"); //Hard fork to v19
+    ADD_CHECKPOINT2(331891,  "faceea4b4ab33fc962c24dfa2f98c2aeda4788f67c1e0044c62419912c1a64fe", "0x7c359086aeb58"); // restart DIFFICULTY_WINDOW
+    ADD_CHECKPOINT2(332100,  "d32c409058c1eceb9a105190c7a5f480b2d6f49f318b18652b49ae971c710124", "0x7c538441cca36");
+    ADD_CHECKPOINT2(334000,  "17d3b15f8e1a73e1c61335ee7979e9e3d211b9055e8a7fb2481e5f49a51b1c22", "0x7ddd5a79d69c4");
    return true;
  }

--- a/src/common/CMakeLists.txt
+++ b/src/common/CMakeLists.txt
@@ -99,7 +99,7 @@ monero_add_library(common
 target_link_libraries(common
  PUBLIC
    cncrypto
-    ${UNBOUND_LIBRARY}
+    ${UNBOUND_LIBRARIES}
    ${LIBUNWIND_LIBRARIES}
    ${Boost_DATE_TIME_LIBRARY}
    ${Boost_FILESYSTEM_LIBRARY}
--- a/src/common/dns_utils.cpp
+++ b/src/common/dns_utils.cpp
@@ -45,11 +45,6 @@ using namespace epee;

 static const char *DEFAULT_DNS_PUBLIC_ADDR[] =
 {
-  "194.150.168.168",    // CCC (Germany)
-  "80.67.169.40",       // FDN (France)
-  "89.233.43.71",       // http://censurfridns.dk (Denmark)
-  "109.69.8.51",        // punCAT (Spain)
-  "193.58.251.251",     // SkyDNS (Russia)
 };

 static boost::mutex instance_lock;
--- a/src/cryptonote_core/blockchain.cpp
+++ b/src/cryptonote_core/blockchain.cpp
@@ -5525,7 +5525,7 @@ void Blockchain::cancel()
 }

 #if defined(PER_BLOCK_CHECKPOINT)
-static const char expected_block_hashes_hash[] = "6dd0d016366b906ed9e493f721d3b3f60c0db628774206424651b6e8f2a76a95";
+static const char expected_block_hashes_hash[] = "25fd44a93e0880a3d69c62d7f7c429d9f04ff345c812a04936773b2fbad78868";
 void Blockchain::load_compiled_in_block_hashes(const GetCheckpointsCallback& get_checkpoints)
 {
  if (get_checkpoints == nullptr || !m_fast_sync)
--- a/src/cryptonote_protocol/cryptonote_protocol_handler.inl
+++ b/src/cryptonote_protocol/cryptonote_protocol_handler.inl
@@ -2095,6 +2095,8 @@ skip:
          }
          MDEBUG(context << "Nothing to get from this peer, and it's not ahead of us, all done");
          context.m_state = cryptonote_connection_context::state_normal;
+          if (m_core.get_current_blockchain_height() >= m_core.get_target_blockchain_height())
+            on_connection_synchronized();
          return true;
        }
        uint64_t next_needed_height = m_block_queue.get_next_needed_height(bc_height);
@@ -2242,6 +2244,8 @@ skip:
          }
          MDEBUG(context << "Nothing to get from this peer, and it's not ahead of us, all done");
          context.m_state = cryptonote_connection_context::state_normal;
+          if (m_core.get_current_blockchain_height() >= m_core.get_target_blockchain_height())
+            on_connection_synchronized();
          return true;
        }

@@ -2433,10 +2437,7 @@ skip:
      if (context.m_remote_blockchain_height >= m_core.get_target_blockchain_height())
      {
        if (m_core.get_current_blockchain_height() >= m_core.get_target_blockchain_height())
-        {
-          MGINFO_GREEN("SYNCHRONIZED OK");
          on_connection_synchronized();
-        }
      }
      else
      {
--- a/src/cryptonote_protocol/levin_notify.cpp
+++ b/src/cryptonote_protocol/levin_notify.cpp
@@ -662,7 +662,7 @@ namespace levin

            auto connections = get_out_connections(*zone_->p2p, height);
            if (connections.empty())
-              MWARNING("Unable to send transaction(s) to " << epee::net_utils::zone_to_string(zone_->nzone) <<
+                MDEBUG("Unable to send transaction(s) to " << epee::net_utils::zone_to_string(zone_->nzone) <<
 			" - no suitable outbound connections at height " << height);

            zone_->strand.post(update_channels{zone_, std::move(connections)});
--- a/src/device_trezor/trezor/transport.cpp
+++ b/src/device_trezor/trezor/transport.cpp
@@ -157,7 +157,11 @@ namespace trezor{
 #define PROTO_HEADER_SIZE 6

  static size_t message_size(const google::protobuf::Message &req){
+#if GOOGLE_PROTOBUF_VERSION < 3006001
+    return size_t(req.ByteSize());
+#else
    return req.ByteSizeLong();
+#endif
  }

  static size_t serialize_message_buffer_size(size_t msg_size) {
--- a/src/p2p/net_node.inl
+++ b/src/p2p/net_node.inl
@@ -695,7 +695,7 @@ namespace nodetool
      full_addrs.insert("164.90.230.176:34567");  //  de1.wownodes.com
      full_addrs.insert("64.227.81.144:34567");   //  us1.wownodes.com
      full_addrs.insert("188.166.237.187:34567"); //  sg1.wownodes.com      
-      full_addrs.insert("54.185.62.197:34567");   //  node.suchwow.xyz
+      full_addrs.insert("51.161.131.176:34567");  //  node.suchwow.xyz
      full_addrs.insert("167.114.196.241:34567"); //  wowbux.org
    }
    return full_addrs;
@@ -821,9 +821,14 @@ namespace nodetool
      if (m_nettype == cryptonote::MAINNET)
      {
        return {
-          "xwvz3ekocr3dkyxfkmgm2hvbpzx2ysqmaxgter7znnqrhoicygkfswid.onion:18083",
-          "4pixvbejrvihnkxmduo2agsnmc3rrulrqc7s3cbwwrep6h6hrzsibeqd.onion:18083",
-          "zbjkbsxc5munw3qusl7j2hpcmikhqocdf4pqhnhtpzw5nt5jrmofptid.onion:18083",
+          "v2admi6gbeprxnk6i2oscizhgy4v5ixu6iezkhj5udiwbfjjs2w7dnid.onion:34566",
+          "iy6ry6uudpzvbd72zsipepukp6nsazjdu72n52vg3isfnxqn342flzad.onion:34566",
+          "7ftpbpp6rbgqi5kjmhyin46essnh3eqb3m3rhfi7r2fr33iwkeuer3yd.onion:34566",
+          "j7rf2jcccizcp47y5moehguyuqdpg4lusk642sw4nayuruitqaqbc7ad.onion:34566",
+          "aje53o5z5twne5q2ljw44zkahhsuhjtwaxuburxddbf7n4pfsj4rj6qd.onion:34566",
+          "nepc4lxndsooj2akn7ofrj3ooqc25242obchcag6tw3f2mxrms2uuvyd.onion:34566",
+          "666l2ajxqjgj5lskvbokvworjysgvqag4oitokjuy7wz6juisul4jqad.onion:34566",
+          "ty7ppqozzodz75audgvkprekiiqsovbyrkfdjwadrkbe3etyzloatxad.onion:34566",
        };
      }
      return {};
@@ -831,8 +836,6 @@ namespace nodetool
      if (m_nettype == cryptonote::MAINNET)
      {
        return {
-          "s3l6ke4ed3df466khuebb4poienoingwof7oxtbo6j4n56sghe3a.b32.i2p:18080",
-          "sel36x6fibfzujwvt4hf5gxolz6kd3jpvbjqg6o3ud2xtionyl2q.b32.i2p:18080"
        };
      }
      return {};
@@ -2044,7 +2047,7 @@ namespace nodetool
        }
        else
        {
-          const el::Level level = el::Level::Warning;
+          const el::Level level = el::Level::Debug;
          MCLOG_RED(level, "Debug", "No incoming connections - check firewalls/routers allow port " << get_this_peer_port());
        }
      }
--- a/src/simplewallet/simplewallet.cpp
+++ b/src/simplewallet/simplewallet.cpp
@@ -766,7 +766,7 @@ bool simple_wallet::spendkey(const std::vector<std::string> &args/* = std::vecto
    std::cout << "secret: On device. Not available" << std::endl;
  } else {
    SCOPED_WALLET_UNLOCK();
-    printf("secret: ");
+    printf("secret (key used for mining): ");
    print_secret_key(m_wallet->get_account().get_keys().m_spend_secret_key);
    putchar('\n');
  }
@@ -8922,12 +8922,12 @@ bool simple_wallet::export_transfers(const std::vector<std::string>& args_)

  // header
  file <<
-      boost::format("%8.8s,%9.9s,%8.8s,%25.25s,%20.20s,%20.20s,%64.64s,%16.16s,%14.14s,%100.100s,%20.20s,%s,%s") %
+      boost::format("%8.8s,%9.9s,%8.8s,%25.25s,%20.20s,%20.20s,%64.64s,%16.16s,%14.14s,%106.106s,%20.20s,%s,%s") %
      tr("block") % tr("direction") % tr("unlocked") % tr("timestamp") % tr("amount") % tr("running balance") % tr("hash") % tr("payment ID") % tr("fee") % tr("destination") % tr("amount") % tr("index") % tr("note")
      << std::endl;

  uint64_t running_balance = 0;
-  auto formatter = boost::format("%8.8llu,%9.9s,%8.8s,%25.25s,%20.20s,%20.20s,%64.64s,%16.16s,%14.14s,%100.100s,%20.20s,\"%s\",%s");
+  auto formatter = boost::format("%8.8llu,%9.9s,%8.8s,%25.25s,%20.20s,%20.20s,%64.64s,%16.16s,%14.14s,%106.106s,%20.20s,\"%s\",%s");

  for (const auto& transfer : all_transfers)
  {
--- a/src/version.cpp.in
+++ b/src/version.cpp.in
@@ -1,5 +1,5 @@
 #define DEF_MONERO_VERSION_TAG "@VERSIONTAG@"
-#define DEF_MONERO_VERSION "0.10.0.0"
+#define DEF_MONERO_VERSION "0.10.0.2"
 #define DEF_MONERO_RELEASE_NAME "Junkie Jeff"
 #define DEF_MONERO_VERSION_FULL DEF_MONERO_VERSION "-" DEF_MONERO_VERSION_TAG
 #define DEF_MONERO_VERSION_IS_RELEASE @VERSION_IS_RELEASE@
--- a/src/wallet/api/CMakeLists.txt
+++ b/src/wallet/api/CMakeLists.txt
@@ -35,12 +35,16 @@ set(wallet_api_sources
  wallet_manager.cpp
  transaction_info.cpp
  transaction_history.cpp
+  transaction_construction_info.cpp
+  pending_transaction_info.cpp
  pending_transaction.cpp
  utils.cpp
  address_book.cpp
  subaddress.cpp
  subaddress_account.cpp
-  unsigned_transaction.cpp)
+  unsigned_transaction.cpp
+  coins.cpp
+  coins_info.cpp)

 set(wallet_api_headers
    wallet2_api.h)
@@ -50,12 +54,16 @@ set(wallet_api_private_headers
  wallet_manager.h
  transaction_info.h
  transaction_history.h
+  transaction_construction_info.h
+  pending_transaction_info.h
  pending_transaction.h
  common_defines.h
  address_book.h
  subaddress.h
  subaddress_account.h
-  unsigned_transaction.h)
+  unsigned_transaction.h
+  coins.h
+  coins_info.h)

 monero_private_headers(wallet_api
  ${wallet_api_private_headers})
--- a/src/wallet/api/coins.cpp
+++ b/src/wallet/api/coins.cpp
@@ -0,0 +1,122 @@
+#include "coins.h"
+#include "coins_info.h"
+#include "wallet.h"
+#include "crypto/hash.h"
+#include "wallet/wallet2.h"
+#include "common_defines.h"
+
+#include <string>
+#include <vector>
+
+using namespace epee;
+
+namespace Monero {
+
+    Coins::~Coins() = default;
+
+    CoinsImpl::CoinsImpl(WalletImpl *wallet)
+            : m_wallet(wallet) {}
+
+    CoinsImpl::~CoinsImpl()
+    {
+        for (auto t : m_rows)
+            delete t;
+    }
+
+    int CoinsImpl::count() const
+    {
+        boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+        int result = m_rows.size();
+        return result;
+    }
+
+    CoinsInfo *CoinsImpl::coin(int index) const
+    {
+        boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+        // sanity check
+        if (index < 0)
+            return nullptr;
+        auto index_ = static_cast<unsigned>(index);
+        return index_ < m_rows.size() ? m_rows[index_] : nullptr;
+    }
+
+    std::vector<CoinsInfo *> CoinsImpl::getAll() const
+    {
+        boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+        return m_rows;
+    }
+
+
+    void CoinsImpl::refresh()
+    {
+        LOG_PRINT_L2("Refreshing coins");
+
+        boost::unique_lock<boost::shared_mutex> lock(m_rowsMutex);
+        boost::shared_lock<boost::shared_mutex> transfers_lock(m_wallet->m_wallet->m_transfers_mutex);
+
+        // delete old outputs;
+        for (auto t : m_rows)
+            delete t;
+        m_rows.clear();
+
+        for (size_t i = 0; i < m_wallet->m_wallet->get_num_transfer_details(); ++i)
+        {
+            const tools::wallet2::transfer_details &td = m_wallet->m_wallet->get_transfer_details(i);
+
+            auto ci = new CoinsInfoImpl();
+            ci->m_blockHeight = td.m_block_height;
+            ci->m_hash = string_tools::pod_to_hex(td.m_txid);
+            ci->m_internalOutputIndex = td.m_internal_output_index;
+            ci->m_globalOutputIndex = td.m_global_output_index;
+            ci->m_spent = td.m_spent;
+            ci->m_frozen = td.m_frozen;
+            ci->m_spentHeight = td.m_spent_height;
+            ci->m_amount = td.m_amount;
+            ci->m_rct = td.m_rct;
+            ci->m_keyImageKnown = td.m_key_image_known;
+            ci->m_pkIndex = td.m_pk_index;
+            ci->m_subaddrIndex = td.m_subaddr_index.minor;
+            ci->m_subaddrAccount = td.m_subaddr_index.major;
+            ci->m_address = m_wallet->m_wallet->get_subaddress_as_str(td.m_subaddr_index); // todo: this is expensive, cache maybe?
+            ci->m_addressLabel = m_wallet->m_wallet->get_subaddress_label(td.m_subaddr_index);
+            ci->m_keyImage = string_tools::pod_to_hex(td.m_key_image);
+            ci->m_unlockTime = td.m_tx.unlock_time;
+            ci->m_unlocked = m_wallet->m_wallet->is_transfer_unlocked(td);
+            ci->m_pubKey = string_tools::pod_to_hex(td.get_public_key());
+            ci->m_coinbase = td.m_tx.vin.size() == 1 && td.m_tx.vin[0].type() == typeid(cryptonote::txin_gen);
+
+            m_rows.push_back(ci);
+        }
+    }
+
+    void CoinsImpl::setFrozen(int index)
+    {
+        try
+        {
+            m_wallet->m_wallet->freeze(index);
+            refresh();
+        }
+        catch (const std::exception& e)
+        {
+            LOG_ERROR("setLabel: " << e.what());
+        }
+    }
+
+    void CoinsImpl::thaw(int index)
+    {
+        try
+        {
+            m_wallet->m_wallet->thaw(index);
+            refresh();
+        }
+        catch (const std::exception& e)
+        {
+            LOG_ERROR("thaw: " << e.what());
+        }
+    }
+
+    bool CoinsImpl::isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) {
+        return m_wallet->m_wallet->is_transfer_unlocked(unlockTime, blockHeight);
+    }
+
+} // namespace
--- a/src/wallet/api/coins.h
+++ b/src/wallet/api/coins.h
@@ -0,0 +1,34 @@
+#ifndef WOWLET_COINS_H
+#define WOWLET_COINS_H
+
+#include "wallet/api/wallet2_api.h"
+#include "wallet/wallet2.h"
+
+namespace Monero {
+
+    class WalletImpl;
+
+    class CoinsImpl : public Coins
+    {
+    public:
+        explicit CoinsImpl(WalletImpl * wallet);
+        ~CoinsImpl() override;
+        int count() const override;
+        CoinsInfo * coin(int index) const override;
+        std::vector<CoinsInfo*> getAll() const override;
+        void refresh() override;
+
+        void setFrozen(int index) override;
+        void thaw(int index) override;
+
+        bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) override;
+
+    private:
+        WalletImpl *m_wallet;
+        std::vector<CoinsInfo*> m_rows;
+        mutable boost::shared_mutex   m_rowsMutex;
+    };
+
+}
+
+#endif //WOWLET_COINS_H
--- a/src/wallet/api/coins_info.cpp
+++ b/src/wallet/api/coins_info.cpp
@@ -0,0 +1,118 @@
+#include "coins_info.h"
+
+using namespace std;
+
+namespace Monero {
+
+    CoinsInfo::~CoinsInfo() = default;
+
+    CoinsInfoImpl::CoinsInfoImpl()
+            : m_blockHeight(0)
+            , m_internalOutputIndex(0)
+            , m_globalOutputIndex(0)
+            , m_spent(false)
+            , m_frozen(false)
+            , m_spentHeight(0)
+            , m_amount(0)
+            , m_rct(false)
+            , m_keyImageKnown(false)
+            , m_pkIndex(0)
+            , m_subaddrAccount(0)
+            , m_subaddrIndex(0)
+            , m_unlockTime(0)
+            , m_unlocked(false)
+    {
+
+    }
+
+    CoinsInfoImpl::~CoinsInfoImpl() = default;
+
+    uint64_t CoinsInfoImpl::blockHeight() const
+    {
+        return m_blockHeight;
+    }
+
+    string CoinsInfoImpl::hash() const
+    {
+        return m_hash;
+    }
+
+    size_t CoinsInfoImpl::internalOutputIndex() const {
+        return m_internalOutputIndex;
+    }
+
+    uint64_t CoinsInfoImpl::globalOutputIndex() const
+    {
+        return m_globalOutputIndex;
+    }
+
+    bool CoinsInfoImpl::spent() const
+    {
+        return m_spent;
+    }
+
+    bool CoinsInfoImpl::frozen() const
+    {
+        return m_frozen;
+    }
+
+    uint64_t CoinsInfoImpl::spentHeight() const
+    {
+        return m_spentHeight;
+    }
+
+    uint64_t CoinsInfoImpl::amount() const
+    {
+        return m_amount;
+    }
+
+    bool CoinsInfoImpl::rct() const {
+        return m_rct;
+    }
+
+    bool CoinsInfoImpl::keyImageKnown() const {
+        return m_keyImageKnown;
+    }
+
+    size_t CoinsInfoImpl::pkIndex() const {
+        return m_pkIndex;
+    }
+
+    uint32_t CoinsInfoImpl::subaddrIndex() const {
+        return m_subaddrIndex;
+    }
+
+    uint32_t CoinsInfoImpl::subaddrAccount() const {
+        return m_subaddrAccount;
+    }
+
+    string CoinsInfoImpl::address() const {
+        return m_address;
+    }
+
+    string CoinsInfoImpl::addressLabel() const {
+        return m_addressLabel;
+    }
+
+    string CoinsInfoImpl::keyImage() const {
+        return m_keyImage;
+    }
+
+    uint64_t CoinsInfoImpl::unlockTime() const {
+        return m_unlockTime;
+    }
+
+    bool CoinsInfoImpl::unlocked() const {
+        return m_unlocked;
+    }
+
+    string CoinsInfoImpl::pubKey() const {
+        return m_pubKey;
+    }
+
+    bool CoinsInfoImpl::coinbase() const {
+        return m_coinbase;
+    }
+} // namespace
+
+namespace Bitmonero = Monero;
--- a/src/wallet/api/coins_info.h
+++ b/src/wallet/api/coins_info.h
@@ -0,0 +1,67 @@
+#ifndef WOWLET_COINS_INFO_H
+#define WOWLET_COINS_INFO_H
+
+#include "wallet/api/wallet2_api.h"
+#include <string>
+#include <ctime>
+
+namespace Monero {
+
+    class CoinsImpl;
+
+    class CoinsInfoImpl : public CoinsInfo
+    {
+    public:
+        CoinsInfoImpl();
+        ~CoinsInfoImpl();
+
+        virtual uint64_t blockHeight() const override;
+        virtual std::string hash() const override;
+        virtual size_t internalOutputIndex() const override;
+        virtual uint64_t globalOutputIndex() const override;
+        virtual bool spent() const override;
+        virtual bool frozen() const override;
+        virtual uint64_t spentHeight() const override;
+        virtual uint64_t amount() const override;
+        virtual bool rct() const override;
+        virtual bool keyImageKnown() const override;
+        virtual size_t pkIndex() const override;
+        virtual uint32_t subaddrIndex() const override;
+        virtual uint32_t subaddrAccount() const override;
+        virtual std::string address() const override;
+        virtual std::string addressLabel() const override;
+        virtual std::string keyImage() const override;
+        virtual uint64_t unlockTime() const override;
+        virtual bool unlocked() const override;
+        virtual std::string pubKey() const override;
+        virtual bool coinbase() const override;
+
+    private:
+        uint64_t    m_blockHeight;
+        std::string m_hash;
+        size_t      m_internalOutputIndex;
+        uint64_t    m_globalOutputIndex;
+        bool        m_spent;
+        bool        m_frozen;
+        uint64_t    m_spentHeight;
+        uint64_t    m_amount;
+        bool        m_rct;
+        bool        m_keyImageKnown;
+        size_t      m_pkIndex;
+        uint32_t    m_subaddrIndex;
+        uint32_t    m_subaddrAccount;
+        std::string m_address;
+        std::string m_addressLabel;
+        std::string m_keyImage;
+        uint64_t    m_unlockTime;
+        bool        m_unlocked;
+        std::string m_pubKey;
+        bool        m_coinbase;
+
+        friend class CoinsImpl;
+
+    };
+
+} // namespace
+
+#endif //WOWLET_COINS_INFO_H
--- a/src/wallet/api/pending_transaction.cpp
+++ b/src/wallet/api/pending_transaction.cpp
@@ -35,6 +35,7 @@
 #include "cryptonote_basic/cryptonote_format_utils.h"
 #include "cryptonote_basic/cryptonote_basic_impl.h"
 #include "common/base58.h"
+#include "string_coding.h"

 #include <memory>
 #include <vector>
@@ -263,4 +264,50 @@ std::vector<std::string> PendingTransactionImpl::signersKeys() const {
    return keys;
 }

+std::string PendingTransactionImpl::unsignedTxToBin() const {
+    return m_wallet.m_wallet->dump_tx_to_str(m_pending_tx);
+}
+
+std::string PendingTransactionImpl::unsignedTxToBase64() const {
+    return epee::string_encoding::base64_encode(m_wallet.m_wallet->dump_tx_to_str(m_pending_tx));
+}
+
+std::string PendingTransactionImpl::signedTxToHex(int index) const {
+    auto index_ = static_cast<unsigned>(index);
+    if (index < 0 || index_ >= m_pending_tx.size()) {
+        return "";
+    }
+
+    return epee::string_tools::buff_to_hex_nodelimer(cryptonote::tx_to_blob(m_pending_tx[index_].tx));
+}
+
+size_t PendingTransactionImpl::signedTxSize(int index) const {
+    auto index_ = static_cast<unsigned>(index);
+    if (index < 0 || index_ >= m_pending_tx.size()) {
+        return 0;
+    }
+
+    return cryptonote::tx_to_blob(m_pending_tx[index_].tx).size();
+}
+
+PendingTransactionInfo * PendingTransactionImpl::transaction(int index) const {
+    if (index < 0)
+        return nullptr;
+    auto index_ = static_cast<unsigned>(index);
+    return index_ < m_pending_tx_info.size() ? m_pending_tx_info[index_] : nullptr;
+}
+
+void PendingTransactionImpl::refresh() {
+    for (auto t : m_pending_tx_info)
+        delete t;
+    m_pending_tx_info.clear();
+
+    for (const auto& p : m_pending_tx)
+        m_pending_tx_info.push_back(new PendingTransactionInfoImpl(m_wallet, p));
+}
+
+std::vector<PendingTransactionInfo*> PendingTransactionImpl::getAll() const {
+    return m_pending_tx_info;
+}
+
 }
--- a/src/wallet/api/pending_transaction.h
+++ b/src/wallet/api/pending_transaction.h
@@ -30,6 +30,7 @@

 #include "wallet/api/wallet2_api.h"
 #include "wallet/wallet2.h"
+#include "pending_transaction_info.h"

 #include <string>
 #include <vector>
@@ -53,6 +54,13 @@ public:
    uint64_t txCount() const override;
    std::vector<uint32_t> subaddrAccount() const override;
    std::vector<std::set<uint32_t>> subaddrIndices() const override;
+    std::string unsignedTxToBin() const override;
+    std::string unsignedTxToBase64() const override;
+    std::string signedTxToHex(int index) const override;
+    size_t signedTxSize(int index) const override;
+    void refresh() override;
+    std::vector<PendingTransactionInfo*> getAll() const override;
+    PendingTransactionInfo * transaction(int index) const override;
    // TODO: continue with interface;

    std::string multisigSignData() override;
@@ -66,6 +74,7 @@ private:
    int  m_status;
    std::string m_errorString;
    std::vector<tools::wallet2::pending_tx> m_pending_tx;
+    std::vector<PendingTransactionInfo*> m_pending_tx_info;
    std::unordered_set<crypto::public_key> m_signers;
    std::vector<std::string> m_tx_device_aux;
    std::vector<crypto::key_image> m_key_images;
--- a/src/wallet/api/pending_transaction_info.cpp
+++ b/src/wallet/api/pending_transaction_info.cpp
@@ -0,0 +1,47 @@
+#include "pending_transaction_info.h"
+#include "transaction_construction_info.h"
+
+using namespace std;
+
+namespace Monero {
+
+    PendingTransactionInfo::~PendingTransactionInfo() = default;
+
+    PendingTransactionInfoImpl::PendingTransactionInfoImpl(WalletImpl &wallet, const tools::wallet2::pending_tx & ptx)
+            : m_wallet(wallet)
+            , m_ptx(ptx)
+            , m_constructionData(new TransactionConstructionInfoImpl(wallet, ptx.construction_data))
+    {
+    }
+
+    PendingTransactionInfoImpl::~PendingTransactionInfoImpl() = default;
+
+    uint64_t PendingTransactionInfoImpl::fee() const
+    {
+        return m_ptx.fee;
+    }
+
+    uint64_t PendingTransactionInfoImpl::dust() const
+    {
+        return m_ptx.dust;
+    }
+
+    bool PendingTransactionInfoImpl::dustAddedToFee() const
+    {
+        return m_ptx.dust_added_to_fee;
+    }
+
+    std::string PendingTransactionInfoImpl::txKey() const
+    {
+        return epee::string_tools::pod_to_hex(m_ptx.tx_key);
+    }
+
+    TransactionConstructionInfo * PendingTransactionInfoImpl::constructionData() const {
+        return m_constructionData;
+    }
+
+//    TransactionConstructionInfo::Output TransactionConstructionInfoImpl::change() const {
+//        return Output(
+//                {m_ptx.change_dts.amount, m_ptx.change_dts.address(m_wallet.m_wallet->nettype(), crypto::hash())});
+//    }
+}
--- a/src/wallet/api/pending_transaction_info.h
+++ b/src/wallet/api/pending_transaction_info.h
@@ -0,0 +1,37 @@
+#ifndef WOWLET_PENDING_TX_H
+#define WOWLET_PENDING_TX_H
+
+#include "wallet/api/wallet2_api.h"
+#include "wallet/wallet2.h"
+#include "wallet.h"
+#include <string>
+
+namespace Monero {
+
+class PendingTransactionImpl;
+
+class PendingTransactionInfoImpl : public PendingTransactionInfo
+{
+public:
+    PendingTransactionInfoImpl(WalletImpl &wallet, const tools::wallet2::pending_tx & ptx);
+    ~PendingTransactionInfoImpl() override;
+
+    uint64_t fee() const override;
+    uint64_t dust() const override;
+    bool dustAddedToFee() const override;
+    std::string txKey() const override;
+    TransactionConstructionInfo *constructionData() const override;
+//    Output change() const override;
+
+private:
+    friend class WalletImpl;
+    WalletImpl &m_wallet;
+    tools::wallet2::pending_tx m_ptx;
+    TransactionConstructionInfo *m_constructionData;
+};
+
+}
+
+
+
+#endif //FEATHER_PENDING_TX_H
--- a/src/wallet/api/subaddress.cpp
+++ b/src/wallet/api/subaddress.cpp
@@ -67,7 +67,10 @@ void SubaddressImpl::refresh(uint32_t accountIndex)
  clearRows();
  for (size_t i = 0; i < m_wallet->m_wallet->get_num_subaddresses(accountIndex); ++i)
  {
-    m_rows.push_back(new SubaddressRow(i, m_wallet->m_wallet->get_subaddress_as_str({accountIndex, (uint32_t)i}), m_wallet->m_wallet->get_subaddress_label({accountIndex, (uint32_t)i})));
+      m_rows.push_back(new SubaddressRow(i,
+                                         m_wallet->m_wallet->get_subaddress_as_str({accountIndex, (uint32_t)i}),
+                                         m_wallet->m_wallet->get_subaddress_label({accountIndex, (uint32_t)i}),
+                                         m_wallet->m_wallet->get_subaddress_used({accountIndex, (uint32_t)i})));
  }
 }

--- a/src/wallet/api/transaction_construction_info.cpp
+++ b/src/wallet/api/transaction_construction_info.cpp
@@ -0,0 +1,63 @@
+#include "transaction_construction_info.h"
+
+using namespace std;
+
+namespace Monero {
+    TransactionConstructionInfo::~TransactionConstructionInfo() = default;
+
+    TransactionConstructionInfo::Input::Input(uint64_t _amount, const std::string &_pubkey)
+            : amount(_amount), pubkey(_pubkey) {}
+
+    TransactionConstructionInfo::Output::Output(uint64_t _amount, const std::string &_address)
+            : amount(_amount), address(_address) {}
+
+    TransactionConstructionInfoImpl::TransactionConstructionInfoImpl(WalletImpl &wallet, const tools::wallet2::tx_construction_data & txcd)
+            : m_wallet(wallet)
+            , m_txcd(txcd) {}
+
+    TransactionConstructionInfoImpl::~TransactionConstructionInfoImpl() = default;
+
+    uint64_t TransactionConstructionInfoImpl::unlockTime() const {
+        return m_txcd.unlock_time;
+    }
+
+    std::set<std::uint32_t> TransactionConstructionInfoImpl::subaddressIndices() const {
+        return m_txcd.subaddr_indices;
+    }
+
+    std::vector<std::string> TransactionConstructionInfoImpl::subaddresses() const {
+        std::vector<std::string> s;
+        auto major = m_txcd.subaddr_account;
+        for (const auto &minor : m_txcd.subaddr_indices) {
+            s.push_back(m_wallet.m_wallet->get_subaddress_as_str({major, minor}));
+        }
+        return s;
+    }
+
+    uint64_t TransactionConstructionInfoImpl::minMixinCount() const {
+        uint64_t min_mixin = -1;
+        for (const auto &source : m_txcd.sources) {
+            size_t mixin = source.outputs.size() - 1;
+            if (mixin < min_mixin)
+                min_mixin = mixin;
+        }
+
+        return min_mixin;
+    }
+
+    std::vector<TransactionConstructionInfo::Input> TransactionConstructionInfoImpl::inputs() const {
+        std::vector<Input> inputs;
+        for (const auto &i : m_txcd.sources) {
+            inputs.emplace_back(i.amount, epee::string_tools::pod_to_hex(i.real_out_tx_key));
+        }
+        return inputs;
+    }
+
+    std::vector<TransactionConstructionInfo::Output> TransactionConstructionInfoImpl::outputs() const {
+        std::vector<Output> outputs;
+        for (const auto &o : m_txcd.splitted_dsts) {
+            outputs.emplace_back(o.amount, o.address(m_wallet.m_wallet->nettype(), crypto::hash()));
+        }
+        return outputs;
+    }
+}
--- a/src/wallet/api/transaction_construction_info.h
+++ b/src/wallet/api/transaction_construction_info.h
@@ -0,0 +1,32 @@
+#ifndef WOWLET_TRANSACTION_CONSTRUCTION_INFO_H
+#define WOWLET_TRANSACTION_CONSTRUCTION_INFO_H
+
+#include "wallet/api/wallet2_api.h"
+#include "wallet/wallet2.h"
+#include "wallet.h"
+#include <string>
+
+namespace Monero {
+
+class TransactionConstructionInfoImpl : public TransactionConstructionInfo
+{
+public:
+    TransactionConstructionInfoImpl(WalletImpl &wallet, const tools::wallet2::tx_construction_data & ptx);
+    ~TransactionConstructionInfoImpl() override;
+
+    uint64_t unlockTime() const override;
+    std::set<std::uint32_t> subaddressIndices() const override;
+    std::vector<std::string> subaddresses() const override;
+    uint64_t minMixinCount() const override;
+    std::vector<Input> inputs() const override;
+    std::vector<Output> outputs() const override;
+
+private:
+    friend class WalletImpl;
+    WalletImpl &m_wallet;
+    tools::wallet2::tx_construction_data m_txcd;
+};
+
+}
+
+#endif //WOWLET_TRANSACTION_CONSTRUCTION_INFO_H
--- a/src/wallet/api/transaction_history.cpp
+++ b/src/wallet/api/transaction_history.cpp
@@ -199,6 +199,9 @@ void TransactionHistoryImpl::refresh()
            ti->m_transfers.push_back({d.amount, d.address(m_wallet->m_wallet->nettype(), pd.m_payment_id)});
        }

+        for (const auto &r: pd.m_rings) {
+            ti->m_rings.push_back({string_tools::pod_to_hex(r.first), cryptonote::relative_output_offsets_to_absolute(r.second)});
+        }
        m_history.push_back(ti);
    }

@@ -229,10 +232,15 @@ void TransactionHistoryImpl::refresh()
        ti->m_label = pd.m_subaddr_indices.size() == 1 ? m_wallet->m_wallet->get_subaddress_label({pd.m_subaddr_account, *pd.m_subaddr_indices.begin()}) : "";
        ti->m_timestamp = pd.m_timestamp;
        ti->m_confirmations = 0;
-        for (const auto &d : pd.m_dests)
+
+        for (const auto &d : pd.m_dests) {
        {
            ti->m_transfers.push_back({d.amount, d.address(m_wallet->m_wallet->nettype(), pd.m_payment_id)});
-        }        
+        }
+
+        for (const auto &r: pd.m_rings) {
+            ti->m_rings.push_back({string_tools::pod_to_hex(r.first), cryptonote::relative_output_offsets_to_absolute(r.second)});
+        }
        m_history.push_back(ti);
    }
    
@@ -266,3 +274,4 @@ void TransactionHistoryImpl::refresh()
 }

 } // namespace
+}
--- a/src/wallet/api/transaction_info.cpp
+++ b/src/wallet/api/transaction_info.cpp
@@ -139,6 +139,11 @@ const std::vector<TransactionInfo::Transfer> &TransactionInfoImpl::transfers() c
    return m_transfers;
 }

+const std::vector<std::pair<std::string, std::vector<uint64_t>>> &TransactionInfoImpl::rings() const
+{
+    return m_rings;
+}
+
 uint64_t TransactionInfoImpl::confirmations() const
 {
    return m_confirmations;
--- a/src/wallet/api/transaction_info.h
+++ b/src/wallet/api/transaction_info.h
@@ -63,6 +63,8 @@ public:
    virtual uint64_t confirmations() const override;
    virtual uint64_t unlockTime() const override;

+    virtual const std::vector<std::pair<std::string, std::vector<uint64_t>>> &rings() const override;
+
 private:
    int         m_direction;
    bool        m_pending;
@@ -81,6 +83,7 @@ private:
    std::vector<Transfer> m_transfers;
    uint64_t    m_confirmations;
    uint64_t    m_unlock_time;
+    std::vector<std::pair<std::string, std::vector<uint64_t>>> m_rings;

    friend class TransactionHistoryImpl;

--- a/src/wallet/api/unsigned_transaction.cpp
+++ b/src/wallet/api/unsigned_transaction.cpp
@@ -31,6 +31,7 @@
 #include "unsigned_transaction.h"
 #include "wallet.h"
 #include "common_defines.h"
+#include "transaction_construction_info.h"

 #include "cryptonote_basic/cryptonote_format_utils.h"
 #include "cryptonote_basic/cryptonote_basic_impl.h"
@@ -315,4 +316,24 @@ uint64_t UnsignedTransactionImpl::minMixinCount() const
    return min_mixin;
 }

+TransactionConstructionInfo * UnsignedTransactionImpl::transaction(int index) const {
+    if (index < 0)
+        return nullptr;
+    auto index_ = static_cast<unsigned>(index);
+    return index_ < m_constructionInfo.size() ? m_constructionInfo[index_] : nullptr;
+}
+
+void UnsignedTransactionImpl::refresh() {
+    for (auto t : m_constructionInfo)
+        delete t;
+    m_constructionInfo.clear();
+
+    for (const auto& p : m_unsigned_tx_set.txes)
+        m_constructionInfo.push_back(new TransactionConstructionInfoImpl(m_wallet, p));
+}
+
+std::vector<TransactionConstructionInfo*> UnsignedTransactionImpl::getAll() const {
+    return m_constructionInfo;
+}
+
 } // namespace
--- a/src/wallet/api/unsigned_transaction.h
+++ b/src/wallet/api/unsigned_transaction.h
@@ -55,6 +55,9 @@ public:
    bool sign(const std::string &signedFileName) override;
    std::string confirmationMessage() const override {return m_confirmationMessage;}
    uint64_t minMixinCount() const override;
+    void refresh() override;
+    std::vector<TransactionConstructionInfo*> getAll() const override;
+    TransactionConstructionInfo * transaction(int index) const override;

 private:
    // Callback function to check all loaded tx's and generate confirmationMessage
@@ -67,7 +70,7 @@ private:
    std::string m_errorString;
    tools::wallet2::unsigned_tx_set m_unsigned_tx_set;
    std::string m_confirmationMessage;
+    std::vector<TransactionConstructionInfo*> m_constructionInfo;
 };

-
 }
--- a/src/wallet/api/wallet.cpp
+++ b/src/wallet/api/wallet.cpp
@@ -35,9 +35,11 @@
 #include "transaction_history.h"
 #include "address_book.h"
 #include "subaddress.h"
+#include "coins.h"
 #include "subaddress_account.h"
 #include "common_defines.h"
 #include "common/util.h"
+#include "string_coding.h"

 #include "mnemonics/electrum-words.h"
 #include "mnemonics/english.h"
@@ -63,8 +65,8 @@ namespace {
    static const int    MAX_REFRESH_INTERVAL_MILLIS = 1000 * 60 * 1;
    // Default refresh interval when connected to remote node
    static const int    DEFAULT_REMOTE_NODE_REFRESH_INTERVAL_MILLIS = 1000 * 10;
-    // Connection timeout 30 sec
-    static const int    DEFAULT_CONNECTION_TIMEOUT_MILLIS = 1000 * 30;
+    // Connection timeout 10 sec
+    static const int    DEFAULT_CONNECTION_TIMEOUT_MILLIS = 1000 * 10;

    std::string get_default_ringdb_path(cryptonote::network_type nettype)
    {
@@ -163,11 +165,8 @@ struct Wallet2CallbackImpl : public tools::i_wallet2_callback
                     << ", tx: " << tx_hash
                     << ", amount: " << print_money(amount)
                     << ", idx: " << subaddr_index);
-        // do not signal on received tx if wallet is not syncronized completely
-        if (m_listener && m_wallet->synchronized()) {
-            m_listener->moneyReceived(tx_hash, amount);
-            m_listener->updated();
-        }
+        m_listener->moneyReceived(tx_hash, amount);
+        m_listener->updated();
    }

    virtual void on_unconfirmed_money_received(uint64_t height, const crypto::hash &txid, const cryptonote::transaction& tx, uint64_t amount, const cryptonote::subaddress_index& subaddr_index)
@@ -179,11 +178,8 @@ struct Wallet2CallbackImpl : public tools::i_wallet2_callback
                     << ", tx: " << tx_hash
                     << ", amount: " << print_money(amount)
                     << ", idx: " << subaddr_index);
-        // do not signal on received tx if wallet is not syncronized completely
-        if (m_listener && m_wallet->synchronized()) {
-            m_listener->unconfirmedMoneyReceived(tx_hash, amount);
-            m_listener->updated();
-        }
+        m_listener->unconfirmedMoneyReceived(tx_hash, amount);
+        m_listener->updated();
    }

    virtual void on_money_spent(uint64_t height, const crypto::hash &txid, const cryptonote::transaction& in_tx,
@@ -195,11 +191,8 @@ struct Wallet2CallbackImpl : public tools::i_wallet2_callback
                     << ", tx: " << tx_hash
                     << ", amount: " << print_money(amount)
                     << ", idx: " << subaddr_index);
-        // do not signal on sent tx if wallet is not syncronized completely
-        if (m_listener && m_wallet->synchronized()) {
-            m_listener->moneySpent(tx_hash, amount);
-            m_listener->updated();
-        }
+        m_listener->moneySpent(tx_hash, amount);
+        m_listener->updated();
    }

    virtual void on_skip_transaction(uint64_t height, const crypto::hash &txid, const cryptonote::transaction& tx)
@@ -433,15 +426,12 @@ WalletImpl::WalletImpl(NetworkType nettype, uint64_t kdf_rounds)
    m_refreshEnabled = false;
    m_addressBook.reset(new AddressBookImpl(this));
    m_subaddress.reset(new SubaddressImpl(this));
+    m_coins.reset(new CoinsImpl(this));
    m_subaddressAccount.reset(new SubaddressAccountImpl(this));


    m_refreshIntervalMillis = DEFAULT_REFRESH_INTERVAL_MILLIS;

-    m_refreshThread = boost::thread([this] () {
-        this->refreshThreadFunc();
-    });
-
 }

 WalletImpl::~WalletImpl()
@@ -760,6 +750,35 @@ bool WalletImpl::recover(const std::string &path, const std::string &password, c
    return status() == Status_Ok;
 }

+bool WalletImpl::recoverDeterministicWalletFromSpendKey(const std::string &path, const std::string &password, const std::string &language, const std::string &spendkey_string)
+{
+    clearStatus();
+    m_errorString.clear();
+
+    m_recoveringFromSeed = true;
+    m_recoveringFromDevice = false;
+
+    // parse spend key
+    crypto::secret_key spendkey;
+    if (!spendkey_string.empty()) {
+        cryptonote::blobdata spendkey_data;
+        if(!epee::string_tools::parse_hexstr_to_binbuff(spendkey_string, spendkey_data) || spendkey_data.size() != sizeof(crypto::secret_key))
+        {
+            setStatusError(tr("failed to parse secret spend key"));
+            return false;
+        }
+        spendkey = *reinterpret_cast<const crypto::secret_key*>(spendkey_data.data());
+    }
+
+    try {
+        m_wallet->generate(path, password, spendkey, true, false);
+        setSeedLanguage(language);
+    } catch (const std::exception &e) {
+        setStatusCritical(e.what());
+    }
+    return status() == Status_Ok;
+}
+
 bool WalletImpl::close(bool store)
 {

@@ -836,6 +855,11 @@ bool WalletImpl::setPassword(const std::string &password)
    return status() == Status_Ok;
 }

+const std::string& WalletImpl::getPassword() const
+{
+    return m_password;
+}
+
 bool WalletImpl::setDevicePin(const std::string &pin)
 {
    clearStatus();
@@ -863,6 +887,27 @@ std::string WalletImpl::address(uint32_t accountIndex, uint32_t addressIndex) co
    return m_wallet->get_subaddress_as_str({accountIndex, addressIndex});
 }

+bool WalletImpl::subaddressIndex(std::string address, std::pair<uint32_t, uint32_t> &index) const
+{
+    clearStatus();
+    cryptonote::address_parse_info info;
+
+    if (!cryptonote::get_account_address_from_str(info, m_wallet->nettype(), address)) {
+        setStatusError(tr("Failed to parse address"));
+        return false;
+    }
+
+    auto i = m_wallet->get_subaddress_index(info.address);
+    if (!i) {
+        setStatusError(tr("Address doesn't belong to the wallet"));
+        return false;
+    }
+
+    index.first = i->major;
+    index.second = i->minor;
+    return true;
+}
+
 std::string WalletImpl::integratedAddress(const std::string &payment_id) const
 {
    crypto::hash8 pid;
@@ -1031,7 +1076,7 @@ uint64_t WalletImpl::daemonBlockChainHeight() const
    if(m_wallet->light_wallet()) {
        return m_wallet->get_light_wallet_scanned_block_height();
    }
-    if (!m_is_connected)
+    if (!m_is_connected && m_synchronized)
        return 0;
    std::string err;
    uint64_t result = m_wallet->get_daemon_blockchain_height(err);
@@ -1050,7 +1095,7 @@ uint64_t WalletImpl::daemonBlockChainTargetHeight() const
    if(m_wallet->light_wallet()) {
        return m_wallet->get_light_wallet_blockchain_height();
    }
-    if (!m_is_connected)
+    if (!m_is_connected && m_synchronized)
        return 0;
    std::string err;
    uint64_t result = m_wallet->get_daemon_blockchain_target_height(err);
@@ -1147,6 +1192,48 @@ UnsignedTransaction *WalletImpl::loadUnsignedTx(const std::string &unsigned_file
  return transaction;
 }

+UnsignedTransaction *WalletImpl::loadUnsignedTxFromStr(const std::string &unsigned_tx) {
+    clearStatus();
+
+    UnsignedTransactionImpl * transaction = new UnsignedTransactionImpl(*this);
+    if (!m_wallet->parse_unsigned_tx_from_str(unsigned_tx, transaction->m_unsigned_tx_set)) {
+        setStatusError(tr("Failed to load unsigned transactions"));
+        transaction->m_status = UnsignedTransaction::Status::Status_Error;
+        transaction->m_errorString = errorString();
+
+        return transaction;
+    }
+
+    // Check tx data and construct confirmation message
+    std::string extra_message;
+    if (!transaction->m_unsigned_tx_set.transfers.second.empty())
+        extra_message = (boost::format("%u outputs to import. ") % (unsigned)transaction->m_unsigned_tx_set.transfers.second.size()).str();
+    transaction->checkLoadedTx([&transaction](){return transaction->m_unsigned_tx_set.txes.size();}, [&transaction](size_t n)->const tools::wallet2::tx_construction_data&{return transaction->m_unsigned_tx_set.txes[n];}, extra_message);
+    setStatus(transaction->status(), transaction->errorString());
+
+    return transaction;
+}
+
+UnsignedTransaction *WalletImpl::loadUnsignedTxFromBase64Str(const std::string &unsigned_tx_base64) {
+    clearStatus();
+
+    std::string decoded_tx = epee::string_encoding::base64_decode(unsigned_tx_base64);
+
+    return this->loadUnsignedTxFromStr(decoded_tx);
+}
+
+PendingTransaction *WalletImpl::loadSignedTx(const std::string &signed_filename) {
+    clearStatus();
+    PendingTransactionImpl * transaction = new PendingTransactionImpl(*this);
+
+    if (!m_wallet->load_tx(signed_filename, transaction->m_pending_tx)) {
+        setStatusError(tr("Failed to load unsigned transactions"));
+        return transaction;
+    }
+
+    return transaction;
+}
+
 bool WalletImpl::submitTransaction(const string &fileName) {
  clearStatus();
  std::unique_ptr<PendingTransactionImpl> transaction(new PendingTransactionImpl(*this));
@@ -1175,7 +1262,7 @@ bool WalletImpl::exportKeyImages(const string &filename, bool all)
  
  try
  {
-    if (!m_wallet->export_key_images(filename), all)
+    if (!m_wallet->export_key_images(filename, all))
    {
      setStatusError(tr("failed to save file ") + filename);
      return false;
@@ -1275,6 +1362,91 @@ bool WalletImpl::importOutputs(const string &filename)
    return true;
 }

+bool WalletImpl::importTransaction(const std::string &txid, std::vector<uint64_t> &o_indices, uint64_t height, uint8_t block_version, uint64_t ts, bool miner_tx, bool pool, bool double_spend_seen)
+{
+    try
+    {
+        m_wallet->import_tx(txid, o_indices, height, block_version, ts, miner_tx, pool, double_spend_seen);
+    }
+    catch (const std::exception &e)
+    {
+        LOG_ERROR("Failed to import transaction: " << e.what());
+        setStatusError(string(tr("Failed to import transaction: ")) + e.what());
+        return false;
+    }
+
+    return true;
+}
+
+std::string WalletImpl::printBlockchain()
+{
+    return m_wallet->printBlockchain();
+}
+std::string WalletImpl::printTransfers()
+{
+    return m_wallet->printTransfers();
+}
+std::string WalletImpl::printPayments()
+{
+    return m_wallet->printPayments();
+}
+std::string WalletImpl::printUnconfirmedPayments()
+{
+    return m_wallet->printUnconfirmedPayments();
+}
+std::string WalletImpl::printConfirmedTransferDetails()
+{
+    return m_wallet->printConfirmedTransferDetails();
+}
+std::string WalletImpl::printUnconfirmedTransferDetails()
+{
+    return m_wallet->printUnconfirmedTransferDetails();
+}
+std::string WalletImpl::printPubKeys()
+{
+    return m_wallet->printPubKeys();
+}
+std::string WalletImpl::printTxNotes()
+{
+    return m_wallet->printTxNotes();
+}
+std::string WalletImpl::printSubaddresses()
+{
+    return m_wallet->printSubaddresses();
+}
+std::string WalletImpl::printSubaddressLabels()
+{
+    return m_wallet->printSubaddressLabels();
+}
+std::string WalletImpl::printAdditionalTxKeys()
+{
+    return m_wallet->printAdditionalTxKeys();
+}
+std::string WalletImpl::printAttributes()
+{
+    return m_wallet->printAttributes();
+}
+std::string WalletImpl::printKeyImages()
+{
+    return m_wallet->printKeyImages();
+}
+std::string WalletImpl::printAccountTags()
+{
+    return m_wallet->printAccountTags();
+}
+std::string WalletImpl::printTxKeys()
+{
+    return m_wallet->printTxKeys();
+}
+std::string WalletImpl::printAddressBook()
+{
+    return m_wallet->printAddressBook();
+}
+std::string WalletImpl::printScannedPoolTxs()
+{
+    return m_wallet->printScannedPoolTxs();
+}
+
 void WalletImpl::addSubaddressAccount(const std::string& label)
 {
    m_wallet->add_subaddress_account(label);
@@ -1652,6 +1824,137 @@ PendingTransaction *WalletImpl::createTransaction(const string &dst_addr, const
    return createTransactionMultDest(std::vector<string> {dst_addr}, payment_id, amount ? (std::vector<uint64_t> {*amount}) : (optional<std::vector<uint64_t>>()), mixin_count, priority, subaddr_account, subaddr_indices);
 }

+PendingTransaction *WalletImpl::createTransactionSingle(const string &key_image, const string &dst_addr,
+                                                        const size_t outputs, PendingTransaction::Priority priority)
+{
+    clearStatus();
+    // Pause refresh thread while creating transaction
+    pauseRefresh();
+
+    cryptonote::address_parse_info info;
+
+    size_t fake_outs_count = m_wallet->adjust_mixin(m_wallet->default_mixin());
+
+    //uint32_t adjusted_priority = m_wallet->adjust_priority(static_cast<uint32_t>(priority));
+
+    PendingTransactionImpl * transaction = new PendingTransactionImpl(*this);
+
+    do {
+        std::vector<uint8_t> extra;
+        std::string extra_nonce;
+        vector<cryptonote::tx_destination_entry> dsts;
+
+        bool error = false;
+
+        crypto::key_image ki;
+        if (!epee::string_tools::hex_to_pod(key_image, ki))
+        {
+            setStatusError(tr("failed to parse key image"));
+            error = true;
+            break;
+        }
+
+        if (!cryptonote::get_account_address_from_str_or_url(info, m_wallet->nettype(), dst_addr))
+        {
+            setStatusError(tr("Invalid destination address"));
+            error = true;
+            break;
+        }
+        if (info.has_payment_id) {
+            if (!extra_nonce.empty()) {
+                setStatusError(tr("a single transaction cannot use more than one payment id"));
+                error = true;
+                break;
+            }
+            set_encrypted_payment_id_to_tx_extra_nonce(extra_nonce, info.payment_id);
+        }
+        if (error) {
+            break;
+        }
+        if (!extra_nonce.empty() && !add_extra_nonce_to_tx_extra(extra, extra_nonce)) {
+            setStatusError(tr("failed to set up payment id, though it was decoded correctly"));
+            break;
+        }
+        try {
+            transaction->m_pending_tx = m_wallet->create_transactions_single(ki, info.address, info.is_subaddress,
+                                                                             outputs, fake_outs_count, 0 /* unlock time */, priority, extra);
+
+            pendingTxPostProcess(transaction);
+
+            if (multisig().isMultisig) {
+                auto tx_set = m_wallet->make_multisig_tx_set(transaction->m_pending_tx);
+                transaction->m_pending_tx = tx_set.m_ptx;
+                transaction->m_signers = tx_set.m_signers;
+            }
+        } catch (const tools::error::daemon_busy&) {
+            // TODO: make it translatable with "tr"?
+            setStatusError(tr("daemon is busy. Please try again later."));
+        } catch (const tools::error::no_connection_to_daemon&) {
+            setStatusError(tr("no connection to daemon. Please make sure daemon is running."));
+        } catch (const tools::error::wallet_rpc_error& e) {
+            setStatusError(tr("RPC error: ") +  e.to_string());
+        } catch (const tools::error::get_outs_error &e) {
+            setStatusError((boost::format(tr("failed to get outputs to mix: %s")) % e.what()).str());
+        } catch (const tools::error::not_enough_unlocked_money& e) {
+            std::ostringstream writer;
+
+            writer << boost::format(tr("not enough money to transfer, available only %s, sent amount %s")) %
+                      print_money(e.available()) %
+                      print_money(e.tx_amount());
+            setStatusError(writer.str());
+        } catch (const tools::error::not_enough_money& e) {
+            std::ostringstream writer;
+
+            writer << boost::format(tr("not enough money to transfer, overall balance only %s, sent amount %s")) %
+                      print_money(e.available()) %
+                      print_money(e.tx_amount());
+            setStatusError(writer.str());
+        } catch (const tools::error::tx_not_possible& e) {
+            std::ostringstream writer;
+
+            writer << boost::format(tr("not enough money to transfer, available only %s, transaction amount %s = %s + %s (fee)")) %
+                      print_money(e.available()) %
+                      print_money(e.tx_amount() + e.fee())  %
+                      print_money(e.tx_amount()) %
+                      print_money(e.fee());
+            setStatusError(writer.str());
+        } catch (const tools::error::not_enough_outs_to_mix& e) {
+            std::ostringstream writer;
+            writer << tr("not enough outputs for specified ring size") << " = " << (e.mixin_count() + 1) << ":";
+            for (const std::pair<uint64_t, uint64_t> outs_for_amount : e.scanty_outs()) {
+                writer << "\n" << tr("output amount") << " = " << print_money(outs_for_amount.first) << ", " << tr("found outputs to use") << " = " << outs_for_amount.second;
+            }
+            writer << "\n" << tr("Please sweep unmixable outputs.");
+            setStatusError(writer.str());
+        } catch (const tools::error::tx_not_constructed&) {
+            setStatusError(tr("transaction was not constructed"));
+        } catch (const tools::error::tx_rejected& e) {
+            std::ostringstream writer;
+            writer << (boost::format(tr("transaction %s was rejected by daemon with status: ")) % get_transaction_hash(e.tx())) <<  e.status();
+            setStatusError(writer.str());
+        } catch (const tools::error::tx_sum_overflow& e) {
+            setStatusError(e.what());
+        } catch (const tools::error::zero_destination&) {
+            setStatusError(tr("one of destinations is zero"));
+        } catch (const tools::error::tx_too_big& e) {
+            setStatusError(tr("failed to find a suitable way to split transactions"));
+        } catch (const tools::error::transfer_error& e) {
+            setStatusError(string(tr("unknown transfer error: ")) + e.what());
+        } catch (const tools::error::wallet_internal_error& e) {
+            setStatusError(string(tr("internal error: ")) + e.what());
+        } catch (const std::exception& e) {
+            setStatusError(string(tr("unexpected error: ")) + e.what());
+        } catch (...) {
+            setStatusError(tr("unknown error"));
+        }
+    } while (false);
+
+    statusWithErrorString(transaction->m_status, transaction->m_errorString);
+    // Resume refresh thread
+    startRefresh();
+    return transaction;
+}
+
 PendingTransaction *WalletImpl::createSweepUnmixableTransaction()

 {
@@ -1755,6 +2058,7 @@ uint64_t WalletImpl::estimateTransactionFee(const std::vector<std::pair<std::str
        extra_size,
        m_wallet->use_fork_rules(8, 0),
        m_wallet->use_fork_rules(HF_VERSION_CLSAG, 0),
+        true,
        m_wallet->get_base_fee(),
        m_wallet->get_fee_multiplier(m_wallet->adjust_priority(static_cast<uint32_t>(priority))),
        m_wallet->get_fee_quantization_mask());
@@ -1770,6 +2074,11 @@ AddressBook *WalletImpl::addressBook()
    return m_addressBook.get();
 }

+Coins *WalletImpl::coins()
+{
+    return m_coins.get();
+}
+
 Subaddress *WalletImpl::subaddress()
 {
    return m_subaddress.get();
@@ -2238,37 +2547,34 @@ void WalletImpl::refreshThreadFunc()

 void WalletImpl::doRefresh()
 {
+    bool success = true;
    bool rescan = m_refreshShouldRescan.exchange(false);
    // synchronizing async and sync refresh calls
    boost::lock_guard<boost::mutex> guarg(m_refreshMutex2);
    do try {
        LOG_PRINT_L3(__FUNCTION__ << ": doRefresh, rescan = "<<rescan);
-        // Syncing daemon and refreshing wallet simultaneously is very resource intensive.
-        // Disable refresh if wallet is disconnected or daemon isn't synced.
-        if (m_wallet->light_wallet() || daemonSynced()) {
-            if(rescan)
-                m_wallet->rescan_blockchain(false);
-            m_wallet->refresh(trustedDaemon());
-            if (!m_synchronized) {
-                m_synchronized = true;
-            }
-            // assuming if we have empty history, it wasn't initialized yet
-            // for further history changes client need to update history in
-            // "on_money_received" and "on_money_sent" callbacks
-            if (m_history->count() == 0) {
-                m_history->refresh();
-            }
-            m_wallet->find_and_save_rings(false);
-        } else {
-           LOG_PRINT_L3(__FUNCTION__ << ": skipping refresh - daemon is not synced");
+        if(rescan)
+            m_wallet->rescan_blockchain(false);
+        m_wallet->refresh(trustedDaemon());
+        if (!m_synchronized) {
+            m_synchronized = true;
        }
+        // assuming if we have empty history, it wasn't initialized yet
+        // for further history changes client need to update history in
+        // "on_money_received" and "on_money_sent" callbacks
+        if (m_history->count() == 0) {
+            m_history->refresh();
+        }
+        m_wallet->find_and_save_rings(false);
    } catch (const std::exception &e) {
+        success = false;
        setStatusError(e.what());
        break;
    }while(!rescan && (rescan=m_refreshShouldRescan.exchange(false))); // repeat if not rescanned and rescan was requested

+    m_is_connected = success;
    if (m_wallet2Callback->getListener()) {
-        m_wallet2Callback->getListener()->refreshed();
+        m_wallet2Callback->getListener()->refreshed(success);
    }
 }

@@ -2331,8 +2637,14 @@ void WalletImpl::pendingTxPostProcess(PendingTransactionImpl * pending)

 bool WalletImpl::doInit(const string &daemon_address, const std::string &proxy_address, uint64_t upper_transaction_size_limit, bool ssl)
 {
-    if (!m_wallet->init(daemon_address, m_daemon_login, proxy_address, upper_transaction_size_limit))
-       return false;
+    if (!m_wallet->init(daemon_address,
+                        m_daemon_login,
+                        proxy_address,
+                        upper_transaction_size_limit,
+                        trustedDaemon(),
+                        ssl ? epee::net_utils::ssl_support_t::e_ssl_support_autodetect : epee::net_utils::ssl_support_t::e_ssl_support_disabled)) {
+        return false;
+    }

    // in case new wallet, this will force fast-refresh (pulling hashes instead of blocks)
    // If daemon isn't synced a calculated block height will be used instead
--- a/src/wallet/api/wallet.h
+++ b/src/wallet/api/wallet.h
@@ -46,8 +46,11 @@ class PendingTransactionImpl;
 class UnsignedTransactionImpl;
 class AddressBookImpl;
 class SubaddressImpl;
+class CoinsImpl;
 class SubaddressAccountImpl;
 struct Wallet2CallbackImpl;
+class PendingTransactionInfoImpl;
+class TransactionConstructionInfoImpl;

 class WalletImpl : public Wallet
 {
@@ -76,6 +79,10 @@ public:
                            const std::string &address_string, 
                            const std::string &viewkey_string,
                            const std::string &spendkey_string = "");
+    bool recoverDeterministicWalletFromSpendKey(const std::string &path,
+                                                const std::string &password,
+                                                const std::string &language,
+                                                const std::string &spendkey_string);
    bool recoverFromDevice(const std::string &path,
                           const std::string &password,
                           const std::string &device_name);
@@ -89,9 +96,11 @@ public:
    std::string errorString() const override;
    void statusWithErrorString(int& status, std::string& errorString) const override;
    bool setPassword(const std::string &password) override;
+    const std::string& getPassword() const override;
    bool setDevicePin(const std::string &password) override;
    bool setDevicePassphrase(const std::string &password) override;
    std::string address(uint32_t accountIndex = 0, uint32_t addressIndex = 0) const override;
+    bool subaddressIndex(std::string address, std::pair<uint32_t, uint32_t> &index) const override;
    std::string integratedAddress(const std::string &payment_id) const override;
    std::string secretViewKey() const override;
    std::string publicViewKey() const override;
@@ -162,19 +171,46 @@ public:
                                        PendingTransaction::Priority priority = PendingTransaction::Priority_Low,
                                        uint32_t subaddr_account = 0,
                                        std::set<uint32_t> subaddr_indices = {}) override;
+
+    PendingTransaction * createTransactionSingle(const std::string &key_image, const std::string &dst_addr,
+                                                 size_t outputs = 1, PendingTransaction::Priority priority = PendingTransaction::Priority_Low) override;
+
    virtual PendingTransaction * createSweepUnmixableTransaction() override;
    bool submitTransaction(const std::string &fileName) override;
    virtual UnsignedTransaction * loadUnsignedTx(const std::string &unsigned_filename) override;
+    virtual UnsignedTransaction * loadUnsignedTxFromStr(const std::string &unsigned_tx) override;
+    virtual UnsignedTransaction * loadUnsignedTxFromBase64Str(const std::string &unsigned_tx) override;
+    virtual PendingTransaction * loadSignedTx(const std::string &signed_filename) override;
    bool exportKeyImages(const std::string &filename, bool all = false) override;
    bool importKeyImages(const std::string &filename) override;
    bool exportOutputs(const std::string &filename, bool all = false) override;
    bool importOutputs(const std::string &filename) override;
+    bool importTransaction(const std::string &txid, std::vector<uint64_t> &o_indices, uint64_t height, uint8_t block_version, uint64_t ts, bool miner_tx, bool pool, bool double_spend_seen) override;
+
+    virtual std::string printBlockchain() override;
+    virtual std::string printTransfers() override;
+    virtual std::string printPayments() override;
+    virtual std::string printUnconfirmedPayments() override;
+    virtual std::string printConfirmedTransferDetails() override;
+    virtual std::string printUnconfirmedTransferDetails() override;
+    virtual std::string printPubKeys() override;
+    virtual std::string printTxNotes() override;
+    virtual std::string printSubaddresses() override;
+    virtual std::string printSubaddressLabels() override;
+    virtual std::string printAdditionalTxKeys() override;
+    virtual std::string printAttributes() override;
+    virtual std::string printKeyImages() override;
+    virtual std::string printAccountTags() override;
+    virtual std::string printTxKeys() override;
+    virtual std::string printAddressBook() override;
+    virtual std::string printScannedPoolTxs() override;

    virtual void disposeTransaction(PendingTransaction * t) override;
    virtual uint64_t estimateTransactionFee(const std::vector<std::pair<std::string, uint64_t>> &destinations,
                                            PendingTransaction::Priority priority) const override;
    virtual TransactionHistory * history() override;
    virtual AddressBook * addressBook() override;
+    virtual Coins * coins() override;
    virtual Subaddress * subaddress() override;
    virtual SubaddressAccount * subaddressAccount() override;
    virtual void setListener(WalletListener * l) override;
@@ -244,7 +280,10 @@ private:
    friend struct Wallet2CallbackImpl;
    friend class AddressBookImpl;
    friend class SubaddressImpl;
+    friend class CoinsImpl;
    friend class SubaddressAccountImpl;
+    friend class PendingTransactionInfoImpl;
+    friend class TransactionConstructionInfoImpl;

    std::unique_ptr<tools::wallet2> m_wallet;
    mutable boost::mutex m_statusMutex;
@@ -255,6 +294,7 @@ private:
    std::unique_ptr<Wallet2CallbackImpl> m_wallet2Callback;
    std::unique_ptr<AddressBookImpl>  m_addressBook;
    std::unique_ptr<SubaddressImpl>  m_subaddress;
+    std::unique_ptr<CoinsImpl> m_coins;
    std::unique_ptr<SubaddressAccountImpl>  m_subaddressAccount;

    // multi-threaded refresh stuff
--- a/src/wallet/api/wallet2_api.h
+++ b/src/wallet/api/wallet2_api.h
@@ -66,6 +66,47 @@ enum NetworkType : uint8_t {
        bool set;
    };

+/*
+ * @brief Transaction construction data
+ */
+struct TransactionConstructionInfo
+{
+    struct Input {
+        Input(uint64_t _amount, const std::string &_pubkey);
+        const uint64_t amount;
+        const std::string pubkey;
+    };
+
+    struct Output {
+        Output(uint64_t _amount, const std::string &_address);
+        const uint64_t amount;
+        const std::string address;
+    };
+
+    virtual ~TransactionConstructionInfo() = 0;
+    virtual uint64_t unlockTime() const = 0;
+    virtual std::set<std::uint32_t> subaddressIndices() const = 0;
+    virtual std::vector<std::string> subaddresses() const = 0;
+    virtual uint64_t minMixinCount() const = 0;
+    virtual std::vector<Input> inputs() const = 0;
+    virtual std::vector<Output> outputs() const = 0;
+};
+
+
+/*
+* @brief Detailed pending transaction information
+*/
+struct PendingTransactionInfo
+{
+    virtual ~PendingTransactionInfo() = 0;
+    virtual uint64_t fee() const = 0;
+    virtual uint64_t dust() const = 0;
+    virtual bool dustAddedToFee() const = 0;
+    virtual std::string txKey() const = 0;
+    virtual TransactionConstructionInfo * constructionData() const = 0;
+};
+
+
 /**
 * @brief Transaction-like interface for sending money
 */
@@ -101,6 +142,13 @@ struct PendingTransaction
    virtual uint64_t txCount() const = 0;
    virtual std::vector<uint32_t> subaddrAccount() const = 0;
    virtual std::vector<std::set<uint32_t>> subaddrIndices() const = 0;
+    virtual std::string unsignedTxToBin() const = 0;
+    virtual std::string unsignedTxToBase64() const = 0;
+    virtual std::string signedTxToHex(int index) const = 0;
+    virtual size_t signedTxSize(int index) const = 0;
+    virtual PendingTransactionInfo * transaction(int index) const = 0;
+    virtual void refresh() = 0;
+    virtual std::vector<PendingTransactionInfo*> getAll() const = 0;

    /**
     * @brief multisigSignData
@@ -160,6 +208,9 @@ struct UnsignedTransaction
    * return - true on success
    */
    virtual bool sign(const std::string &signedFileName) = 0;
+    virtual void refresh() = 0;
+    virtual std::vector<TransactionConstructionInfo*> getAll() const = 0;
+    virtual TransactionConstructionInfo * transaction(int index) const = 0;
 };

 /**
@@ -198,6 +249,7 @@ struct TransactionInfo
    virtual std::string paymentId() const = 0;
    //! only applicable for output transactions
    virtual const std::vector<Transfer> & transfers() const = 0;
+    virtual const std::vector<std::pair<std::string, std::vector<uint64_t>>> & rings() const = 0;
 };
 /**
 * @brief The TransactionHistory - interface for displaying transaction history
@@ -260,22 +312,66 @@ struct AddressBook
    virtual int lookupPaymentID(const std::string &payment_id) const = 0;
 };

+/**
+ * @brief The CoinsInfo - interface for displaying coins information
+ */
+struct CoinsInfo
+{
+    virtual ~CoinsInfo() = 0;
+
+    virtual uint64_t blockHeight() const = 0;
+    virtual std::string hash() const = 0;
+    virtual size_t internalOutputIndex() const = 0;
+    virtual uint64_t globalOutputIndex() const = 0;
+    virtual bool spent() const = 0;
+    virtual bool frozen() const = 0;
+    virtual uint64_t spentHeight() const = 0;
+    virtual uint64_t amount() const = 0;
+    virtual bool rct() const = 0;
+    virtual bool keyImageKnown() const = 0;
+    virtual size_t pkIndex() const = 0;
+    virtual uint32_t subaddrIndex() const = 0;
+    virtual uint32_t subaddrAccount() const = 0;
+    virtual std::string address() const = 0;
+    virtual std::string addressLabel() const = 0;
+    virtual std::string keyImage() const = 0;
+    virtual uint64_t unlockTime() const = 0;
+    virtual bool unlocked() const = 0;
+    virtual std::string pubKey() const = 0;
+    virtual bool coinbase() const = 0;
+};
+
+struct Coins
+{
+    virtual ~Coins() = 0;
+    virtual int count() const = 0;
+    virtual CoinsInfo * coin(int index)  const = 0;
+    virtual std::vector<CoinsInfo*> getAll() const = 0;
+    virtual void refresh() = 0;
+    virtual void setFrozen(int index) = 0;
+    virtual void thaw(int index) = 0;
+    virtual bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) = 0;
+};
+
 struct SubaddressRow {
 public:
-    SubaddressRow(std::size_t _rowId, const std::string &_address, const std::string &_label):
+    SubaddressRow(std::size_t _rowId, const std::string &_address, const std::string &_label, bool _used):
        m_rowId(_rowId),
        m_address(_address),
-        m_label(_label) {}
+        m_label(_label),
+        m_used(_used) {}
 
 private:
    std::size_t m_rowId;
    std::string m_address;
    std::string m_label;
+    bool m_used;
 public:
    std::string extra;
    std::string getAddress() const {return m_address;}
    std::string getLabel() const {return m_label;}
    std::size_t getRowId() const {return m_rowId;}
+    bool isUsed() const {return m_used;}
 };

 struct Subaddress
@@ -382,7 +478,7 @@ struct WalletListener
    /**
     * @brief refreshed - called when wallet refreshed by background thread or explicitly refreshed by calling "refresh" synchronously
     */
-    virtual void refreshed() = 0;
+    virtual void refreshed(bool success) = 0;

    /**
     * @brief called by device if the action is required
@@ -456,9 +552,11 @@ struct Wallet
    //! returns both error and error string atomically. suggested to use in instead of status() and errorString()
    virtual void statusWithErrorString(int& status, std::string& errorString) const = 0;
    virtual bool setPassword(const std::string &password) = 0;
+    virtual const std::string& getPassword() const = 0;
    virtual bool setDevicePin(const std::string &pin) { (void)pin; return false; };
    virtual bool setDevicePassphrase(const std::string &passphrase) { (void)passphrase; return false; };
    virtual std::string address(uint32_t accountIndex = 0, uint32_t addressIndex = 0) const = 0;
+    virtual bool subaddressIndex(std::string address, std::pair<uint32_t, uint32_t> &index) const = 0;
    std::string mainAddress() const { return address(0, 0); }
    virtual std::string path() const = 0;
    virtual NetworkType nettype() const = 0;
@@ -868,6 +966,18 @@ struct Wallet
                                                   uint32_t subaddr_account = 0,
                                                   std::set<uint32_t> subaddr_indices = {}) = 0;

+    /*!
+     * \brief createTransactionSingle creates transaction with single input
+     * \param key_image               key image as string
+     * \param dst_addr                destination address as string
+     * \param priority
+     * \return                        PendingTransaction object. caller is responsible to check PendingTransaction::status()
+     *                                after object returned
+     */
+
+    virtual PendingTransaction * createTransactionSingle(const std::string &key_image, const std::string &dst_addr,
+                                                         size_t outputs = 1, PendingTransaction::Priority = PendingTransaction::Priority_Low) = 0;
+
    /*!
     * \brief createSweepUnmixableTransaction creates transaction with unmixable outputs.
     * \return                  PendingTransaction object. caller is responsible to check PendingTransaction::status()
@@ -882,7 +992,27 @@ struct Wallet
    *                          after object returned
    */
    virtual UnsignedTransaction * loadUnsignedTx(const std::string &unsigned_filename) = 0;
-    
+
+    /*!
+     * \brief loadUnsignedTx  - creates transaction from unsigned tx string
+     * \return                - UnsignedTransaction object. caller is responsible to check UnsignedTransaction::status()
+     *                          after object returned
+     */
+    virtual UnsignedTransaction * loadUnsignedTxFromStr(const std::string &unsigned_tx) = 0;
+
+    /*!
+     * \brief loadUnsignedTx  - creates transaction from unsigned base64 encoded tx string
+     * \return                - UnsignedTransaction object. caller is responsible to check UnsignedTransaction::status()
+     *                          after object returned
+     */
+    virtual UnsignedTransaction * loadUnsignedTxFromBase64Str(const std::string &unsigned_tx_base64) = 0;
+
+    /*!
+     * \brief loadSignedTx    - creates transaction from signed tx file
+     * \return                - PendingTransaction object.
+     */
+    virtual PendingTransaction * loadSignedTx(const std::string &signed_filename) = 0;
+
   /*!
    * \brief submitTransaction - submits transaction in signed tx file
    * \return                  - true on success
@@ -933,8 +1063,29 @@ struct Wallet
     */
    virtual bool importOutputs(const std::string &filename) = 0;

+    virtual bool importTransaction(const std::string &txid, std::vector<uint64_t> &o_indices, uint64_t height, uint8_t block_version, uint64_t ts, bool miner_tx, bool pool, bool double_spend_seen) = 0;
+
+    virtual std::string printBlockchain() = 0;
+    virtual std::string printTransfers() = 0;
+    virtual std::string printPayments() = 0;
+    virtual std::string printUnconfirmedPayments() = 0;
+    virtual std::string printConfirmedTransferDetails() = 0;
+    virtual std::string printUnconfirmedTransferDetails() = 0;
+    virtual std::string printPubKeys() = 0;
+    virtual std::string printTxNotes() = 0;
+    virtual std::string printSubaddresses() = 0;
+    virtual std::string printSubaddressLabels() = 0;
+    virtual std::string printAdditionalTxKeys() = 0;
+    virtual std::string printAttributes() = 0;
+    virtual std::string printKeyImages() = 0;
+    virtual std::string printAccountTags() = 0;
+    virtual std::string printTxKeys() = 0;
+    virtual std::string printAddressBook() = 0;
+    virtual std::string printScannedPoolTxs() = 0;
+
    virtual TransactionHistory * history() = 0;
    virtual AddressBook * addressBook() = 0;
+    virtual Coins * coins() = 0;
    virtual Subaddress * subaddress() = 0;
    virtual SubaddressAccount * subaddressAccount() = 0;
    virtual void setListener(WalletListener *) = 0;
@@ -991,7 +1142,8 @@ struct Wallet
    /*
     * \brief signMessage - sign a message with the spend private key
     * \param message - the message to sign (arbitrary byte data)
-     * \return the signature
+     * \param address - the address to make the signature with, defaults to primary address (optional)
+     * \return the signature, empty string if the address is invalid or does not belong to the wallet
     */
    virtual std::string signMessage(const std::string &message, const std::string &address = "") = 0;
    /*!
@@ -1200,6 +1352,25 @@ struct WalletManager
        return createWalletFromKeys(path, password, language, testnet ? TESTNET : MAINNET, restoreHeight, addressString, viewKeyString, spendKeyString);
    }

+    /*!
+     * \brief  recover deterministic wallet from spend key.
+     * \param  path           Name of wallet file to be created
+     * \param  password       Password of wallet file
+     * \param  language       language
+     * \param  nettype        Network type
+     * \param  restoreHeight  restore from start height
+     * \param  spendKeyString spend key
+     * \param  kdf_rounds     Number of rounds for key derivation function
+     * \return                Wallet instance (Wallet::status() needs to be called to check if recovered successfully)
+     */
+    virtual Wallet * createDeterministicWalletFromSpendKey(const std::string &path,
+                                                           const std::string &password,
+                                                           const std::string &language,
+                                                           NetworkType nettype,
+                                                           uint64_t restoreHeight,
+                                                           const std::string &spendKeyString,
+                                                           uint64_t kdf_rounds = 1) = 0;
+
   /*!
    * \deprecated this method creates a wallet WITHOUT a passphrase, use createWalletFromKeys(..., password, ...) instead
    * \brief  recovers existing wallet using keys. Creates a view only wallet if spend key is omitted
--- a/src/wallet/api/wallet_manager.cpp
+++ b/src/wallet/api/wallet_manager.cpp
@@ -122,6 +122,22 @@ Wallet *WalletManagerImpl::createWalletFromKeys(const std::string &path,
    return wallet;
 }

+Wallet *WalletManagerImpl::createDeterministicWalletFromSpendKey(const std::string &path,
+                                                                 const std::string &password,
+                                                                 const std::string &language,
+                                                                 NetworkType nettype,
+                                                                 uint64_t restoreHeight,
+                                                                 const std::string &spendkey_string,
+                                                                 uint64_t kdf_rounds)
+{
+    WalletImpl * wallet = new WalletImpl(nettype, kdf_rounds);
+    if(restoreHeight > 0){
+        wallet->setRefreshFromBlockHeight(restoreHeight);
+    }
+    wallet->recoverDeterministicWalletFromSpendKey(path, password, language, spendkey_string);
+    return wallet;
+}
+
 Wallet *WalletManagerImpl::createWalletFromDevice(const std::string &path,
                                                  const std::string &password,
                                                  NetworkType nettype,
--- a/src/wallet/api/wallet_manager.h
+++ b/src/wallet/api/wallet_manager.h
@@ -67,6 +67,13 @@ public:
                                                    const std::string &addressString,
                                                    const std::string &viewKeyString,
                                                    const std::string &spendKeyString = "") override;
+    virtual Wallet * createDeterministicWalletFromSpendKey(const std::string &path,
+                                                           const std::string &password,
+                                                           const std::string &language,
+                                                           NetworkType nettype,
+                                                           uint64_t restoreHeight,
+                                                           const std::string &spendkey_string,
+                                                           uint64_t kdf_rounds) override;
    virtual Wallet * createWalletFromDevice(const std::string &path,
                                            const std::string &password,
                                            NetworkType nettype,
--- a/src/wallet/node_rpc_proxy.cpp
+++ b/src/wallet/node_rpc_proxy.cpp
@@ -51,7 +51,7 @@ using namespace epee;
 namespace tools
 {

-static const std::chrono::seconds rpc_timeout = std::chrono::minutes(3) + std::chrono::seconds(30);
+static const std::chrono::seconds rpc_timeout = std::chrono::seconds(10);

 NodeRPCProxy::NodeRPCProxy(epee::net_utils::http::abstract_http_client &http_client, rpc_payment_state_t &rpc_payment_state, boost::recursive_mutex &mutex)
  : m_http_client(http_client)
@@ -162,7 +162,7 @@ boost::optional<std::string> NodeRPCProxy::get_target_height(uint64_t &height)
  auto res = get_info();
  if (res)
    return res;
-  height = m_target_height;
+  height = m_target_height > m_height ? m_target_height : m_height;
  return boost::optional<std::string>();
 }

--- a/src/wallet/wallet2.cpp
+++ b/src/wallet/wallet2.cpp
@@ -1537,6 +1537,14 @@ void wallet2::add_subaddress_account(const std::string& label)
  m_subaddress_labels[index_major][0] = label;
 }
 //----------------------------------------------------------------------------------------------------
+bool wallet2::get_subaddress_used(const cryptonote::subaddress_index& index)
+{
+  return std::find_if(m_transfers.begin(), m_transfers.end(),
+  [this, index](const transfer_details &td) {
+  return td.m_subaddr_index == index;
+  }) != m_transfers.end();
+}
+//----------------------------------------------------------------------------------------------------
 void wallet2::add_subaddress(uint32_t index_major, const std::string& label)
 {
  THROW_WALLET_EXCEPTION_IF(index_major >= m_subaddress_labels.size(), error::account_index_outofbound);
@@ -2169,13 +2177,14 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
          uint64_t amount = tx.vout[o].amount ? tx.vout[o].amount : tx_scan_info[o].amount;
          if (!pool)
          {
-	    m_transfers.push_back(transfer_details{});
-	    transfer_details& td = m_transfers.back();
-	    td.m_block_height = height;
-	    td.m_internal_output_index = o;
-	    td.m_global_output_index = o_indices[o];
-	    td.m_tx = (const cryptonote::transaction_prefix&)tx;
-	    td.m_txid = txid;
+            boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
+            m_transfers.push_back(transfer_details{});
+            transfer_details& td = m_transfers.back();
+            td.m_block_height = height;
+            td.m_internal_output_index = o;
+            td.m_global_output_index = o_indices[o];
+            td.m_tx = (const cryptonote::transaction_prefix&)tx;
+            td.m_txid = txid;
            td.m_key_image = tx_scan_info[o].ki;
            td.m_key_image_known = !m_watch_only && !m_multisig;
            if (!td.m_key_image_known)
@@ -2233,6 +2242,8 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
                update_multisig_rescan_info(*m_multisig_rescan_k, *m_multisig_rescan_info, m_transfers.size() - 1);
            }
 	    LOG_PRINT_L0("Received money: " << print_money(td.amount()) << ", with tx: " << txid);
+        lock.unlock();
+
 	    if (0 != m_callback)
 	      m_callback->on_money_received(height, txid, tx, td.m_amount, td.m_subaddr_index, spends_one_of_ours(tx), td.m_tx.unlock_time);
          }
@@ -2271,12 +2282,13 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
          uint64_t extra_amount = amount - m_transfers[kit->second].amount();
          if (!pool)
          {
+            boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
            transfer_details &td = m_transfers[kit->second];
-	    td.m_block_height = height;
-	    td.m_internal_output_index = o;
-	    td.m_global_output_index = o_indices[o];
-	    td.m_tx = (const cryptonote::transaction_prefix&)tx;
-	    td.m_txid = txid;
+            td.m_block_height = height;
+            td.m_internal_output_index = o;
+            td.m_global_output_index = o_indices[o];
+            td.m_tx = (const cryptonote::transaction_prefix&)tx;
+            td.m_txid = txid;
            td.m_amount = amount;
            td.m_pk_index = pk_index - 1;
            td.m_subaddr_index = tx_scan_info[o].received->index;
@@ -3212,6 +3224,54 @@ void wallet2::update_pool_state(std::vector<std::tuple<cryptonote::transaction,
  }
  MTRACE("update_pool_state end");
 }
+
+//----------------------------------------------------------------------------------------------------
+void wallet2::import_tx(const std::string &txid, std::vector<uint64_t> &o_indices, uint64_t height, uint8_t block_version, uint64_t ts, bool miner_tx, bool pool, bool double_spend_seen)
+{
+    crypto::hash hash;
+    epee::string_tools::hex_to_pod(txid, hash);
+
+    cryptonote::COMMAND_RPC_GET_TRANSACTIONS::request req;
+    cryptonote::COMMAND_RPC_GET_TRANSACTIONS::response res;
+    req.txs_hashes.push_back(epee::string_tools::pod_to_hex(hash));
+
+    req.decode_as_json = false;
+    req.prune = true;
+
+    bool r;
+    {
+        const boost::lock_guard<boost::recursive_mutex> lock{m_daemon_rpc_mutex};
+        uint64_t pre_call_credits = m_rpc_payment_state.credits;
+        req.client = get_client_signature();
+        r = epee::net_utils::invoke_http_json("/gettransactions", req, res, *m_http_client, rpc_timeout);
+        if (r && res.status == CORE_RPC_STATUS_OK)
+            check_rpc_cost("/gettransactions", res.credits, pre_call_credits, res.txs.size() * COST_PER_TX);
+    }
+
+    MDEBUG("Got " << r << " and " << res.status);
+    if (!(r && res.status == CORE_RPC_STATUS_OK)) {
+        THROW_WALLET_EXCEPTION(error::wallet_internal_error, "Error calling gettransactions daemon RPC: r " + std::to_string(r) + ", status " + get_rpc_status(res.status));
+    }
+
+    if (res.txs.size() != 1) {
+        THROW_WALLET_EXCEPTION(error::wallet_internal_error, "Expected 1 tx, got " + std::to_string(res.txs.size()));
+    }
+
+    const auto &tx_entry = res.txs[0];
+    cryptonote::transaction tx;
+    cryptonote::blobdata bd;
+    crypto::hash tx_hash;
+
+    if (!get_pruned_tx(tx_entry, tx, tx_hash)) {
+        THROW_WALLET_EXCEPTION(error::wallet_internal_error, "Failed to parse transaction from daemon");
+    }
+
+    if (tx_hash != hash) {
+        THROW_WALLET_EXCEPTION(error::wallet_internal_error, "Got txid " + epee::string_tools::pod_to_hex(tx_hash) + " which we did not ask for");
+    }
+
+    process_new_transaction(tx_hash, tx, o_indices, height, block_version, ts, miner_tx, pool, double_spend_seen, {});
+}
 //----------------------------------------------------------------------------------------------------
 void wallet2::process_pool_state(const std::vector<std::tuple<cryptonote::transaction, crypto::hash, bool>> &txs)
 {
@@ -3235,11 +3295,19 @@ void wallet2::fast_refresh(uint64_t stop_height, uint64_t &blocks_start_height,
 {
  std::vector<crypto::hash> hashes;

-  const uint64_t checkpoint_height = m_checkpoints.get_max_height();
+  // Get highest checkpoint that is lower than stop_height
+  uint64_t checkpoint_height = 0;
+  for (auto i : m_checkpoints.get_points()) {
+    if (i.first > stop_height) {
+      break;
+    }
+    checkpoint_height = i.first;
+  }
+
  if ((stop_height > checkpoint_height && m_blockchain.size()-1 < checkpoint_height) && !force)
  {
    // we will drop all these, so don't bother getting them
-    uint64_t missing_blocks = m_checkpoints.get_max_height() - m_blockchain.size();
+    uint64_t missing_blocks = checkpoint_height - m_blockchain.size();
    while (missing_blocks-- > 0)
      m_blockchain.push_back(crypto::null_hash); // maybe a bit suboptimal, but deque won't do huge reallocs like vector
    m_blockchain.push_back(m_checkpoints.get_points().at(checkpoint_height));
@@ -5504,6 +5572,315 @@ void wallet2::write_watch_only_wallet(const std::string& wallet_name, const epee
  bool r = store_keys(new_keys_filename, password, true);
  THROW_WALLET_EXCEPTION_IF(!r, error::file_save_error, new_keys_filename);
 }
+
+std::string wallet2::printBlockchain()
+{
+    std::string blstr;
+    blstr += "offset: " + std::to_string(m_blockchain.offset()) + "\n";
+    blstr += "genesis: " + string_tools::pod_to_hex(m_blockchain.genesis()) + "\n";
+
+    for (size_t i = m_blockchain.offset(); i < m_blockchain.size(); i++) {
+        blstr += std::to_string(i) + " : " + string_tools::pod_to_hex(m_blockchain[i]) + "\n";
+    }
+
+    return blstr;
+}
+
+std::string wallet2::printTransfers()
+{
+    std::string str;
+    for (const auto &td : m_transfers) {
+        str += "block_height: " + std::to_string(td.m_block_height) + "\n";
+        str += printTxPrefix(td.m_tx);
+        str += "txid: " + string_tools::pod_to_hex(td.m_txid) + "\n";
+        str += "internal_output_index: " + std::to_string(td.m_internal_output_index) + "\n";
+        str += "global_output_index: " + std::to_string(td.m_global_output_index) + "\n";
+        str += "spent: " + std::to_string(td.m_spent) + "\n";
+        str += "frozen: " + std::to_string(td.m_frozen) + "\n";
+        str += "spent_height: " + std::to_string(td.m_spent_height) + "\n";
+        str += "key_image: " + string_tools::pod_to_hex(td.m_key_image) + "\n";
+        str += "mask: " + string_tools::pod_to_hex(td.m_mask) + "\n";
+        str += "amount: " + std::to_string(td.m_amount) + "\n";
+        str += "rct: " + std::to_string(td.m_rct) + "\n";
+        str += "key_image_known: " + std::to_string(td.m_key_image_known) + "\n";
+        str += "key_image_request: " + std::to_string(td.m_key_image_request) + "\n";
+        str += "pk_index: " + std::to_string(td.m_pk_index) + "\n";
+        str += "subaddr_index: " + std::to_string(td.m_subaddr_index.major) + "," + std::to_string(td.m_subaddr_index.minor) + "\n";
+        str += "key_image_partial: " + std::to_string(td.m_key_image_partial) + "\n";
+        str += "multisig_k:\n";
+        for (const auto &el : td.m_multisig_k) {
+            str += "  " + string_tools::pod_to_hex(el) + "\n";
+        }
+
+        str += "multisig_info:\n";
+        for (const auto &el : td.m_multisig_info) {
+            str += "  signer: " + string_tools::pod_to_hex(el.m_signer) + "\n";
+            str += "  LR:\n";
+            for (const auto &em : el.m_LR) {
+                str += "    L: " + string_tools::pod_to_hex(em.m_L) + "\n";
+                str += "    R: " + string_tools::pod_to_hex(em.m_R) + "\n";
+            }
+            str += "\n";
+            str += "  partial_key_images:\n";
+            for (const auto &em : el.m_partial_key_images) {
+                str += "    "  + string_tools::pod_to_hex(em) + "\n";
+            }
+            str += "\n";
+        }
+
+        str += "uses:\n";
+        for (const auto &el : td.m_uses) {
+            str += "  " + std::to_string(el.first) + " : " + string_tools::pod_to_hex(el.second) + "\n";
+        }
+        str += "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printUnconfirmedPayments()
+{
+    std::string str;
+    for (const auto &el : m_unconfirmed_payments) {
+        auto ppd = el.second;
+        str += "double_spend_seen: " + std::to_string(ppd.m_double_spend_seen) + "\n";
+        str += printPaymentDetails(ppd.m_pd);
+        str += "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printConfirmedTransferDetails()
+{
+    std::string str;
+    for (const auto &el : m_confirmed_txs) {
+        auto ctd = el.second;
+        str += "amount_in: " + std::to_string(ctd.m_amount_in) + "\n";
+        str += "amount_out: " + std::to_string(ctd.m_amount_out) + "\n";
+        str += "change: " + std::to_string(ctd.m_change) + "\n";
+        str += "block_height: " + std::to_string(ctd.m_block_height) + "\n";
+        str += "dests:\n";
+        for (const auto &em : ctd.m_dests) {
+            str += printTxDestinationEntry(em);
+        }
+        str += "payment_id: " + string_tools::pod_to_hex(ctd.m_payment_id) + "\n";
+        str += "timestamp: " + std::to_string(ctd.m_timestamp) + "\n";
+        str += "unlock_time: " + std::to_string(ctd.m_unlock_time) + "\n";
+        str += "subaddr_account: " + std::to_string(ctd.m_subaddr_account) + "\n";
+        str += "subaddr_indices: ";
+        for (auto em : ctd.m_subaddr_indices) {
+            str += std::to_string(em);
+        }
+        str += "\n\n";
+    }
+    return str;
+}
+
+std::string wallet2::printUnconfirmedTransferDetails()
+{
+    std::string str;
+    for (const auto &el : m_unconfirmed_txs) {
+        auto utd = el.second;
+        str += printTxPrefix(utd.m_tx);
+        str += "amount_in: " + std::to_string(utd.m_amount_in) + "\n";
+        str += "amount_out: " + std::to_string(utd.m_amount_out) + "\n";
+        str += "change: " + std::to_string(utd.m_change) + "\n";
+        str += "sent_time: " + std::to_string(utd.m_sent_time) + "\n";
+        str += "dests:\n";
+        for (const auto &em : utd.m_dests) {
+            str += printTxDestinationEntry(em);
+        }
+        str += "payment_id: " + string_tools::pod_to_hex(utd.m_payment_id) + "\n";
+        str += "timestamp: " + std::to_string(utd.m_timestamp) + "\n";
+        str += "subaddr_account: " + std::to_string(utd.m_subaddr_account) + "\n";
+        str += "subaddr_indices: ";
+        for (auto em : utd.m_subaddr_indices) {
+            str += std::to_string(em);
+        }
+        str += "\n\n";
+    }
+    return str;
+}
+
+std::string wallet2::printPayments()
+{
+    std::string str;
+    for (const auto &el : m_payments) {
+        str += printPaymentDetails(el.second) + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printPubKeys()
+{
+    std::string str;
+    vector<std::pair<crypto::public_key, size_t>> v;
+    for (const auto &el : m_pub_keys) {
+        v.push_back(el);
+    }
+    std::sort(v.begin(), v.end(),
+    [](std::pair<crypto::public_key, size_t> a, std::pair<crypto::public_key, size_t> b){return a.second < b.second;});
+    for (const auto &el : v){
+        str += string_tools::pod_to_hex(el.first) + " : " + boost::to_string(el.second) + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printTxNotes()
+{
+    std::string str;
+    for (std::pair<crypto::hash, std::string> el : m_tx_notes) {
+        str += string_tools::pod_to_hex(el.first) + " : " + el.second + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printSubaddresses()
+{
+    std::string str;
+    vector<std::pair<crypto::public_key, cryptonote::subaddress_index>> v;
+    for (const auto &el : m_subaddresses) {
+        v.push_back(el);
+    }
+    std::sort(v.begin(), v.end(), [](std::pair<crypto::public_key, cryptonote::subaddress_index> a, std::pair<crypto::public_key, cryptonote::subaddress_index> b) {
+        if (a.second.major == b.second.major) {
+            return a.second.minor < b.second.minor;
+        }
+        return a.second.major < b.second.major;
+    });
+    for (const auto &el : v) {
+        str += string_tools::pod_to_hex(el.first) + " : " + std::to_string(el.second.major) + "," + std::to_string(el.second.minor) + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printSubaddressLabels()
+{
+    std::string str;
+    for (size_t i = 0; i < m_subaddress_labels.size(); i++) {
+        for (size_t j = 0; j < m_subaddress_labels[i].size(); j++) {
+            str += std::to_string(i) + "," + std::to_string(j) + " : " + m_subaddress_labels[i][j] + "\n";
+        }
+    }
+    return str;
+}
+
+std::string wallet2::printAdditionalTxKeys()
+{
+    std::string str;
+    for (std::pair<crypto::hash, std::vector<crypto::secret_key>> el : m_additional_tx_keys) {
+        str += "Txid: " + string_tools::pod_to_hex(el.first) + " (" + std::to_string(el.second.size()) + ")\n";
+        for (auto em : el.second) {
+            str += "  " + string_tools::pod_to_hex(em) + "\n";
+        }
+    }
+    return str;
+}
+
+std::string wallet2::printAttributes()
+{
+    std::string str;
+    for (auto el : m_attributes) {
+        str += el.first + " : " + el.second + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printKeyImages()
+{
+    std::string str;
+    vector<std::pair<crypto::key_image, size_t>> v;
+    for (const auto &el : m_key_images) {
+        v.push_back(el);
+    }
+    std::sort(v.begin(), v.end(), [](std::pair<crypto::key_image, size_t> a, std::pair<crypto::key_image, size_t> b){return a.second < b.second;});
+    for (const auto &el: v) {
+        str += string_tools::pod_to_hex(el.first) + " : " + boost::to_string(el.second) + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printAccountTags()
+{
+    std::string str;
+    for (size_t i = 0; i < m_account_tags.second.size(); i++) {
+        str += std::to_string(i) + " : " + m_account_tags.second[i] + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printTxKeys()
+{
+    std::string str;
+    for (std::pair<crypto::hash, crypto::secret_key> el : m_tx_keys) {
+        str += string_tools::pod_to_hex(el.first) + " : " + string_tools::pod_to_hex(el.second) + "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printAddressBook()
+{
+    std::string str;
+    for (auto el : m_address_book) {
+        str += "address: " + string_tools::pod_to_hex(el.m_address) + "\n";
+        str += "payment_id: " + string_tools::pod_to_hex(el.m_payment_id) + "\n";
+        str += "description: " + el.m_description + "\n";
+        str += "is_subaddress: " + std::to_string(el.m_is_subaddress) + "\n";
+        str += "has_payment_id: " + std::to_string(el.m_has_payment_id) + "\n";
+        str += "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printScannedPoolTxs()
+{
+    std::string str;
+    for (size_t i = 0; i < 2; i++) {
+        str += "scanned_pool_txs[" + std::to_string(i) + "]\n";
+        for (auto el : m_scanned_pool_txs[i]) {
+            str += string_tools::pod_to_hex(el) + "\n";
+        }
+        str += "\n";
+    }
+    return str;
+}
+
+std::string wallet2::printTxPrefix(const cryptonote::transaction_prefix &tx)
+{
+    std::string str;
+    str += "tx.version: " + std::to_string(tx.version) + "\n";
+    str += "tx.unlock_time: " + std::to_string(tx.unlock_time) + "\n";
+    return str;
+}
+
+std::string wallet2::printPaymentDetails(const payment_details &pd)
+{
+    std::string str;
+    str += "tx_hash: " + string_tools::pod_to_hex(pd.m_tx_hash) + "\n";
+    str += "amount: " + std::to_string(pd.m_amount) + "\n";
+    str += "amounts: ";
+    for (auto em : pd.m_amounts) {
+        str += std::to_string(em);
+    }
+    str += "\n";
+    str += "fee: " + std::to_string(pd.m_fee) + "\n";
+    str += "block_height: " + std::to_string(pd.m_block_height) + "\n";
+    str += "unlock_time: " + std::to_string(pd.m_unlock_time) + "\n";
+    str += "timestamp: " + std::to_string(pd.m_timestamp) + "\n";
+    str += "coinbase: " + std::to_string(pd.m_coinbase) + "\n";
+    str += "subaddr_index: " + std::to_string(pd.m_subaddr_index.major) + "," + std::to_string(pd.m_subaddr_index.minor) + "\n";
+    return str;
+}
+
+std::string wallet2::printTxDestinationEntry(const cryptonote::tx_destination_entry &tx)
+{
+std::string str;
+str += "  original: " + tx.original + "\n";
+str += "  amount: " + std::to_string(tx.amount) + "\n";
+str += "  addr: " + string_tools::pod_to_hex(tx.addr) + "\n";
+str += "  is_subaddress: " + std::to_string(tx.is_subaddress) + "\n";
+str += "  is_integrated: " + std::to_string(tx.is_integrated) + "\n";
+return str;
+}
 //----------------------------------------------------------------------------------------------------
 void wallet2::wallet_exists(const std::string& file_path, bool& keys_file_exists, bool& wallet_file_exists)
 {
--- a/src/wallet/wallet2.h
+++ b/src/wallet/wallet2.h
@@ -232,7 +232,7 @@ private:
    friend class wallet_keys_unlocker;
    friend class wallet_device_callback;
  public:
-    static constexpr const std::chrono::seconds rpc_timeout = std::chrono::minutes(3) + std::chrono::seconds(30);
+    static constexpr const std::chrono::seconds rpc_timeout = std::chrono::seconds(10);

    enum RefreshType {
      RefreshFull,
@@ -910,6 +910,7 @@ private:
    std::string get_subaddress_as_str(const cryptonote::subaddress_index& index) const;
    std::string get_address_as_str() const { return get_subaddress_as_str({0, 0}); }
    std::string get_integrated_address_as_str(const crypto::hash8& payment_id) const;
+    bool get_subaddress_used(const cryptonote::subaddress_index& index);
    void add_subaddress_account(const std::string& label);
    size_t get_num_subaddress_accounts() const { return m_subaddress_labels.size(); }
    size_t get_num_subaddresses(uint32_t index_major) const { return index_major < m_subaddress_labels.size() ? m_subaddress_labels[index_major].size() : 0; }
@@ -1388,6 +1389,7 @@ private:
    bool import_key_images(std::vector<crypto::key_image> key_images, size_t offset=0, boost::optional<std::unordered_set<size_t>> selected_transfers=boost::none);
    bool import_key_images(signed_tx_set & signed_tx, size_t offset=0, bool only_selected_transfers=false);
    crypto::public_key get_tx_pub_key_from_received_outs(const tools::wallet2::transfer_details &td) const;
+    void import_tx(const std::string &txid, std::vector<uint64_t> &o_indices, uint64_t height, uint8_t block_version, uint64_t ts, bool miner_tx, bool pool, bool double_spend_seen);

    void update_pool_state(std::vector<std::tuple<cryptonote::transaction, crypto::hash, bool>> &process_txs, bool refreshed = false);
    void process_pool_state(const std::vector<std::tuple<cryptonote::transaction, crypto::hash, bool>> &txs);
@@ -1532,6 +1534,27 @@ private:
    uint64_t get_bytes_sent() const;
    uint64_t get_bytes_received() const;

+    std::string printBlockchain();
+    std::string printTransfers();
+    std::string printKeyImages();
+    std::string printUnconfirmedTransferDetails();
+    std::string printPayments();
+    std::string printUnconfirmedPayments();
+    std::string printConfirmedTransferDetails();
+    std::string printPubKeys();
+    std::string printTxNotes();
+    std::string printSubaddresses();
+    std::string printSubaddressLabels();
+    std::string printAdditionalTxKeys();
+    std::string printAttributes();
+    std::string printAccountTags();
+    std::string printTxKeys();
+    std::string printAddressBook();
+    std::string printScannedPoolTxs();
+    std::string printTxPrefix(const cryptonote::transaction_prefix &tx);
+    std::string printPaymentDetails(const payment_details &pd);
+    std::string printTxDestinationEntry(const cryptonote::tx_destination_entry &tx);
+
    // MMS -------------------------------------------------------------------------------------------------
    mms::message_store& get_message_store() { return m_message_store; };
    const mms::message_store& get_message_store() const { return m_message_store; };
@@ -1558,6 +1581,7 @@ private:

    static std::string get_default_daemon_address() { CRITICAL_REGION_LOCAL(default_daemon_address_lock); return default_daemon_address; }

+    boost::shared_mutex m_transfers_mutex;
  private:
    /*!
     * \brief  Stores wallet information to wallet file.
--- a/utils/conf/wownerod.conf
+++ b/utils/conf/wownerod.conf
@@ -1,8 +0,0 @@
-# Configuration for wownerod
-# Syntax: any command line option may be specified as 'clioptionname=value'.
-#         Boolean options such as 'no-igd' are specified as 'no-igd=1'.
-# See 'wownerod --help' for all available options.
-
-data-dir=/var/lib/wownero
-log-file=/var/log/wownero/wownero.log
-log-level=0
--- a/utils/systemd/wownerod.service
+++ b/utils/systemd/wownerod.service
@@ -1,38 +1,17 @@
 [Unit]
 Description=Wownero Full Node
-After=network.target
+After=network-online.target
+Wants=network-online.target

 [Service]
 User=wownero
 Group=wownero
-WorkingDirectory=~
-RuntimeDirectory=wownero
+Environment="MONERO_RANDOMX_UMASK=1"
 StateDirectory=wownero
 LogsDirectory=wownero
-
-# Clearnet config
-#
-Type=forking
-PIDFile=/run/wownero/wownerod.pid
-ExecStart=/usr/bin/wownerod --config-file /etc/wownerod.conf \
-    --detach --pidfile /run/wownero/wownerod.pid
-
-# Tor config
-#
-## We have to use simple, not forking, because we cannot pass --detach
-## because stderr/stdout is not available when detached, but torsocks
-## attempts to write to it, and fails with 'invalid argument', causing
-## wownerod to fail.
-#Type=simple
-#Environment=DNS_PUBLIC=tcp
-## The following is needed only when accessing wallet from a different
-## host in the LAN, VPN, etc, the RPC must bind to 0.0.0.0, but
-## by default torsocks only allows binding to localhost.
-#Environment=TORSOCKS_ALLOW_INBOUND=1
-#ExecStart=/usr/bin/torsocks /usr/bin/wownerod --config-file /etc/wownerod.conf \
-#    --non-interactive
-
+Type=simple
+ExecStart=/usr/local/bin/wownerod --config-file /etc/wownerod.conf --non-interactive
 Restart=always

 [Install]
-WantedBy=multi-user.target
+WantedBy=multi-user.target
--- a/wownerod.conf
+++ b/wownerod.conf
@@ -0,0 +1,28 @@
+#anonymous-inbound=YOUR_ONION_ADDRESS:34566,127.0.0.1:34566,64
+check-updates=disabled
+log-level=0
+no-igd=1
+no-zmq=1
+restricted-rpc=1
+p2p-bind-ip=0.0.0.0
+p2p-bind-port=34567
+public-node=1
+confirm-external-bind=1
+rpc-bind-ip=0.0.0.0
+rpc-bind-port=34568
+rpc-ssl=autodetect
+disable-rpc-ban=1
+db-sync-mode=safe
+out-peers=64
+in-peers=64
+limit-rate-up=1048576
+limit-rate-down=1048576
+tx-proxy=tor,127.0.0.1:9050,23
+add-priority-node=v2admi6gbeprxnk6i2oscizhgy4v5ixu6iezkhj5udiwbfjjs2w7dnid.onion:34568
+add-priority-node=iy6ry6uudpzvbd72zsipepukp6nsazjdu72n52vg3isfnxqn342flzad.onion:34568
+add-priority-node=7ftpbpp6rbgqi5kjmhyin46essnh3eqb3m3rhfi7r2fr33iwkeuer3yd.onion:34568
+add-priority-node=j7rf2jcccizcp47y5moehguyuqdpg4lusk642sw4nayuruitqaqbc7ad.onion:34568
+add-priority-node=aje53o5z5twne5q2ljw44zkahhsuhjtwaxuburxddbf7n4pfsj4rj6qd.onion:34568
+add-priority-node=nepc4lxndsooj2akn7ofrj3ooqc25242obchcag6tw3f2mxrms2uuvyd.onion:34568
+add-priority-node=666l2ajxqjgj5lskvbokvworjysgvqag4oitokjuy7wz6juisul4jqad.onion:34568
+add-priority-node=ty7ppqozzodz75audgvkprekiiqsovbyrkfdjwadrkbe3etyzloatxad.onion:34568
Author	SHA1	Message	Date
wowario	cdb068cd0b	Merge pull request 'upstream' (#402 ) from wowario/wownero:upstream into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/402	2021-07-12 18:04:52 +00:00
wowario	4bb004d488	remove unbound	2021-07-12 20:51:39 +03:00
wowario	2135d96ce5	remove DNS ips	2021-07-12 20:31:04 +03:00
selsta	f2700d8a8c	external: remove unbound submodule	2021-07-12 20:27:05 +03:00
wowario	06a8561506	msg on mining key	2021-07-12 20:16:55 +03:00
wowario	5fc33d80b7	change unable to send transaction warning to debug	2021-07-12 20:09:04 +03:00
moneromooo-monero	dfeafb77b9	protocol: fix delayed "you are now synchronized..." message	2021-07-12 08:47:56 +03:00
selsta	fb21f2748b	simplewallet: don't truncate integ. address in export_transfers	2021-07-12 08:46:49 +03:00
selsta	38551fff2d	trezor: add #if for ByteSizeLong Turns out Ubuntu 18.04 ships with an old protobuf version.	2021-07-12 08:46:28 +03:00
tobtoht	78e3ea51d6	wallet_api: getPassword	2021-07-12 08:45:11 +03:00
wowario	bad59c1225	bump version	2021-07-12 08:38:28 +03:00
wowario	a17acc1dd8	update checkpoints	2021-07-12 08:36:58 +03:00
wowario	f50bd0c801	Merge pull request 'Update lza_menace seed node' (#401 ) from lza_menace-patch-1 into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/401	2021-07-08 00:45:22 +00:00
lza_menace	c498f72c0f	Update lza_menace seed node This old AWS IP is gone	2021-07-07 20:55:36 +00:00
wowario	a92df99e55	Merge pull request 'change no incoming connections warning to debug' (#399 ) from wowario/wownero:warn into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/399	2021-07-06 04:55:06 +00:00
wowario	9b66a396a6	change no incoming connections warning to debug	2021-07-06 07:43:54 +03:00
wowario	942e3abe96	Merge pull request 'add tor stuff' (#397 ) from wowario/wownero:tor into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/397	2021-07-05 08:12:06 +00:00
wowario	047c0a3c23	Merge pull request 'update checkpoints' (#398 ) from wowario/wownero:checkpoints into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/398	2021-07-05 08:06:22 +00:00
wowario	74fbd76b91	change ports	2021-07-05 11:03:42 +03:00
wowario	adf438d0fd	update systemd service file	2021-07-05 11:02:54 +03:00
wowario	783803b5cf	update checkpoints	2021-07-05 09:33:49 +03:00
wowario	e5e56aafb7	add tor stuff	2021-07-04 09:22:10 +03:00
wowario	ff5182f7f2	Merge pull request 'Wowletify' (#396 ) from wowletify into master Reviewed-on: https://git.wownero.com/wownero/wownero/pulls/396	2021-07-04 05:11:56 +00:00
dsc	a5b93c8414	remove unused variable	2021-07-04 00:09:29 +02:00
thotbot	0d751b9be7	Skip unneeded blocks in fast refresh	2021-07-04 00:03:51 +02:00
thotbot	76c875f248	subaddressIndex()	2021-07-04 00:03:51 +02:00
thotbot	dc1821ab0e	Print wallet cache	2021-07-04 00:03:51 +02:00
thotbot	e31e8cd9f0	Misc. network related - Add interface for bytes sent/received - Allow wallet refresh while daemon is not synchronized - emit success boolean for refreshed() - don't call refreshThreadFunc (we don't need it) - lower rpc timeout from 3m30s (?!) to 10 seconds	2021-07-04 00:03:50 +02:00
thotbot	f34e643c18	wallet_api: getPassword	2021-07-03 23:09:00 +02:00
thotbot	39e16ffcf2	Import transaction	2021-07-03 23:05:44 +02:00
thotbot	f5917eabe4	Misc. wallet API and wallet2 changes	2021-07-03 23:00:42 +02:00
thotbot	3121980b17	Coins	2021-07-03 22:15:39 +02:00
thotbot	cebe0ef944	Offline transaction signing	2021-07-03 22:10:22 +02:00
dsc	b6a21de70b	estimate_fee requires new bp+ parameter	2021-07-03 21:40:08 +02:00
wowario	623c14e486	tag for gitian builds	2021-06-29 12:58:00 +03:00